What is the molecular weight of 2-(2-(Diphenylphosphino)ethyl)pyridine?
The molecular weight is 291.3g/mol.
How many heavy atoms are present in the structure of 2-(2-(Diphenylphosphino)ethyl)pyridine?
There are 21 heavy atoms.
What is the CAS number of 2-(2-(Diphenylphosphino)ethyl)pyridine?
The CAS number is 10150-27-3.
What is the Canonical SMILES of 2-(2-(Diphenylphosphino)ethyl)pyridine?
The Canonical SMILES is C1=CC=C(C=C1)P(CCC2=CC=CC=N2)C3=CC=CC=C3.
How many rotatable bonds are present in the structure of 2-(2-(Diphenylphosphino)ethyl)pyridine?
There are 5 rotatable bonds.
What are some synonyms for 2-(2-(Diphenylphosphino)ethyl)pyridine?
Some synonyms include diphenyl(2-pyridin-2-ylethyl)phosphane and 2-[2-(diphenylphosphino)ethyl]pyridine.
What is the InChIKey of 2-(2-(Diphenylphosphino)ethyl)pyridine?
The InChIKey is ARSGXAZDYSTSKI-UHFFFAOYSA-N.
How many hydrogen bond acceptors are present in the structure of 2-(2-(Diphenylphosphino)ethyl)pyridine?
There is 1 hydrogen bond acceptor.
What is the topological polar surface area of 2-(2-(Diphenylphosphino)ethyl)pyridine?
The topological polar surface area is 12.9.
What is the IUPAC name of 2-(2-(Diphenylphosphino)ethyl)pyridine?
The IUPAC name is diphenyl(2-pyridin-2-ylethyl)phosphane.