ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry

2-[2-(Diphenylphosphino)ethyl]pyridine

Catalog Number ACM10150273-2
CAS 10150-27-3
Structure 2-[2-(Diphenylphosphino)ethyl]pyridine
Synonyms 1-(Diphenylphosphino)-2-(2-Pyridyl)Ethane
IUPAC Name diphenyl(2-pyridin-2-ylethyl)phosphane
Molecular Weight 291.33
Molecular Formula C19H18NP
InChI ARSGXAZDYSTSKI-UHFFFAOYSA-N
InChI Key InChI=1S/C19H18NP/c1-3-10-18(11-4-1)21(19-12-5-2-6-13-19)16-14-17-9-7-8-15-20-17/h1-13,15H,14,16H2
Boiling Point 422.2±28.0 °C(Predicted)
Melting Point 58-62 °C
Purity 98%
Appearance Solid
Exact Mass 291.11800
Isomeric SMILES C1=CC=C(C=C1)P(CCC2=CC=CC=N2)C3=CC=CC=C3
pKa 5.56±0.12(Predicted)
Q&A

What is the molecular weight of 2-(2-(Diphenylphosphino)ethyl)pyridine?

The molecular weight is 291.3g/mol.

How many heavy atoms are present in the structure of 2-(2-(Diphenylphosphino)ethyl)pyridine?

There are 21 heavy atoms.

What is the CAS number of 2-(2-(Diphenylphosphino)ethyl)pyridine?

The CAS number is 10150-27-3.

What is the Canonical SMILES of 2-(2-(Diphenylphosphino)ethyl)pyridine?

The Canonical SMILES is C1=CC=C(C=C1)P(CCC2=CC=CC=N2)C3=CC=CC=C3.

How many rotatable bonds are present in the structure of 2-(2-(Diphenylphosphino)ethyl)pyridine?

There are 5 rotatable bonds.

What are some synonyms for 2-(2-(Diphenylphosphino)ethyl)pyridine?

Some synonyms include diphenyl(2-pyridin-2-ylethyl)phosphane and 2-[2-(diphenylphosphino)ethyl]pyridine.

What is the InChIKey of 2-(2-(Diphenylphosphino)ethyl)pyridine?

The InChIKey is ARSGXAZDYSTSKI-UHFFFAOYSA-N.

How many hydrogen bond acceptors are present in the structure of 2-(2-(Diphenylphosphino)ethyl)pyridine?

There is 1 hydrogen bond acceptor.

What is the topological polar surface area of 2-(2-(Diphenylphosphino)ethyl)pyridine?

The topological polar surface area is 12.9.

What is the IUPAC name of 2-(2-(Diphenylphosphino)ethyl)pyridine?

The IUPAC name is diphenyl(2-pyridin-2-ylethyl)phosphane.

Please kindly note that our products and services are for research use only.