2,2'-(cis-1,2-Diaminoethane-1,2-diyl)diphenol

Catalog Number	ACM119386719-1
CAS	119386-71-9
Structure
Synonyms	2,2'-(1,2-Diaminoethane-1,2-Diyl)Diphenol; 2-[1,2-Diamino-2-(2-Hydroxyphenyl)Ethyl]Phenol
IUPAC Name	2-[1,2-diamino-2-(2-hydroxyphenyl)ethyl]phenol
Molecular Weight	244.29
Molecular Formula	C14H16N2O2
InChI	MRNPLGLZBUDMRE-UHFFFAOYSA-N
InChI Key	InChI=1S/C14H16N2O2/c15-13(9-5-1-3-7-11(9)17)14(16)10-6-2-4-8-12(10)18/h1-8,13-14,17-18H,15-16H2
Boiling Point	457.9±40.0 °C(Predicted)
Melting Point	157-162 °C
Purity	98%
Appearance	Solid
Isomeric SMILES	C1=CC=C(C(=C1)C(C(C2=CC=CC=C2O)N)N)O

Q&A

What is the chemical structure of 2,2'-(cis-1,2-Diaminoethane-1,2-diyl)diphenol?

The chemical structure of 2,2'-(cis-1,2-Diaminoethane-1,2-diyl)diphenol is 2,2'-(cis-1,2-Diaminoethane-1,2-diyl)diphenol.

What is the molecular weight of 2,2'-(cis-1,2-Diaminoethane-1,2-diyl)diphenol?

The molecular weight of 2,2'-(cis-1,2-Diaminoethane-1,2-diyl)diphenol is 244.29.

What are the product categories that 2,2'-(cis-1,2-Diaminoethane-1,2-diyl)diphenol belongs to?

The compound belongs to the product categories of Chiral Nitrogen and DPEN Series.

What are the synonyms for 2,2'-(cis-1,2-Diaminoethane-1,2-diyl)diphenol?

Some synonyms for 2,2'-(cis-1,2-Diaminoethane-1,2-diyl)diphenol include (1S,2S)-1,2-Bis(2-hydroxyphenyl)-1,2-ethanediamine and (S,S)-1,2-Bis(2-hydroxyphenyl)ethylenediamine.

What is the melting point of 2,2'-(cis-1,2-Diaminoethane-1,2-diyl)diphenol?

The melting point of 2,2'-(cis-1,2-Diaminoethane-1,2-diyl)diphenol is 157-162 °C.

What is the density of 2,2'-(cis-1,2-Diaminoethane-1,2-diyl)diphenol?

The density of 2,2'-(cis-1,2-Diaminoethane-1,2-diyl)diphenol is 1.294±0.06 g/cm3.

What is the appearance of 2,2'-(cis-1,2-Diaminoethane-1,2-diyl)diphenol?

The compound appears as a white to off-white powder.

What is the optical activity of 2,2'-(cis-1,2-Diaminoethane-1,2-diyl)diphenol?

The optical activity of 2,2'-(cis-1,2-Diaminoethane-1,2-diyl)diphenol is [α]22/D -65°, c = 0.2 in chloroform.

What is the boiling point of 2,2'-(cis-1,2-Diaminoethane-1,2-diyl)diphenol?

The boiling point of 2,2'-(cis-1,2-Diaminoethane-1,2-diyl)diphenol is 457.9±40.0 °C.

What are some of the uses of 2,2'-(cis-1,2-Diaminoethane-1,2-diyl)diphenol?

The compound can be used as a starting material for the synthesis of Schiff base complexes of gold(III) with anticancer activity, and as a stereoinductor in the synthesis of quinoline and isoquinoline based 1,2-diamines.