2,2'-Biquinoline

Catalog Number	ACM119915-1
CAS	119-91-5
Structure
Synonyms	Cuproin; 2,2'-Diquinolyl
IUPAC Name	2-quinolin-2-ylquinoline
Molecular Weight	256.30
Molecular Formula	C18H12N2
Canonical SMILES	C1=CC=C2C(=C1)C=CC(=N2)C3=NC4=CC=CC=C4C=C3
InChI	WPTCSQBWLUUYDV-UHFFFAOYSA-N
InChI Key	InChI=1S/C18H12N2/c1-3-7-15-13(5-1)9-11-17(19-15)18-12-10-14-6-2-4-8-16(14)20-18/h1-12H
Melting Point	192-195 °C-lit.
Purity	98%+
Solubility	3.98e-06 M;
Appearance	Powder or crystal
Storage	Store at +15°C to +25°C.
Complexity	297
Covalently-Bonded Unit Count	1
EC Number	204-357-5
Exact Mass	256.100048391
Heavy Atom Count	20
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	0
Monoisotopic Mass	256.100048391
Rotatable Bond Count	1
Topological Polar Surface Area	25.8 Ų

Q&A

What is the molecular formula of 2,2'-Biquinoline?

The molecular formula of 2,2'-Biquinoline is C18H12N2.

What is the melting point of 2,2'-Biquinoline?

The melting point of 2,2'-Biquinoline is 192-195 °C.

What is the color of 2,2'-Biquinoline?

2,2'-Biquinoline is slightly yellow to light beige in color.

What is the CAS number for 2,2'-Biquinoline?

The CAS number for 2,2'-Biquinoline is 119-91-5.

What is the water solubility of 2,2'-Biquinoline?

2,2'-Biquinoline is sparingly soluble in water (0.001g/L).

What is the application of 2,2'-Biquinoline?

2,2'-Biquinoline, also known as cuprous reagent, is highly selective for the determination of cuprous and can be used as a ligand in the synthesis of heteroleptic Cu(I) complexes for LEDs.

How is 2,2'-Biquinoline used in chemical analysis?

2,2'-Biquinoline is used as a reagent for the spectrophotometric determination of Cu and as an indicator for titration of organolithium reagents.

What is the boiling point of 2,2'-Biquinoline?

The boiling point of 2,2'-Biquinoline is estimated to be 389.54°C.

How is 2,2'-Biquinoline purified?

2,2'-Biquinoline is decolourized in CHCl3 solution using charcoal, then crystallized to a constant melting point from EtOH or pet ether.

What are the safety statements associated with 2,2'-Biquinoline?

The safety statements associated with 2,2'-Biquinoline are 26-36-37/39, indicating it should be kept away from sources of ignition and in a sealed container at room temperature.