ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

[2,2'-Bipyridine]-5-carbonitrile

Catalog Number ACM1802284-1
CAS 1802-28-4
Structure {[CurrentData.Name]}
Synonyms 6-Pyridin-2-Ylpyridine-3-Carbonitrile; 5-Cyano-2,2'-Bipyridine
IUPAC Name 6-pyridin-2-ylpyridine-3-carbonitrile
Molecular Weight 181.19
Molecular Formula C11H7N3
InChI PXIRMJXGWBMBHR-UHFFFAOYSA-N
InChI Key InChI=1S/C11H7N3/c12-7-9-4-5-11(14-8-9)10-3-1-2-6-13-10/h1-6,8H
Boiling Point 351.4±32.0 °C(Predicted)
Melting Point 143-144 °C
Purity 97%
Isomeric SMILES C1=CC=NC(=C1)C2=NC=C(C=C2)C#N
Q&A

What is the CAS number for the compound [2,2'-Bipyridine]-5-carbonitrile?

The CAS number for the compound [2,2'-Bipyridine]-5-carbonitrile is 1802-28-4.

What is the molecular weight of [2,2'-Bipyridine]-5-carbonitrile?

The molecular weight of [2,2'-Bipyridine]-5-carbonitrile is 181.19.

What are some synonyms for [2,2'-Bipyridine]-5-carbonitrile?

Some synonyms for [2,2'-Bipyridine]-5-carbonitrile are 6-pyridin-2-ylpyridine-3-carbonitrile, Methanone, 1,4,7,10,16-Pentaazacyclopentadecane, and [2,2']bipyridinyl-5-carbonitrile.

What is the molecular formula of [2,2'-Bipyridine]-5-carbonitrile?

The molecular formula of [2,2'-Bipyridine]-5-carbonitrile is C11H7N3.

What is the predicted melting point of [2,2'-Bipyridine]-5-carbonitrile?

The predicted melting point of [2,2'-Bipyridine]-5-carbonitrile is 143-144 °C.

What is the predicted density of [2,2'-Bipyridine]-5-carbonitrile?

The predicted density of [2,2'-Bipyridine]-5-carbonitrile is 1.24±0.1 g/cm3.

What is the predicted boiling point of [2,2'-Bipyridine]-5-carbonitrile?

The predicted boiling point of [2,2'-Bipyridine]-5-carbonitrile is 351.4±32.0 °C.

What is the predicted pKa value of [2,2'-Bipyridine]-5-carbonitrile?

The predicted pKa value of [2,2'-Bipyridine]-5-carbonitrile is 3.26±0.22.

How many nitrogen atoms are present in the structure of [2,2'-Bipyridine]-5-carbonitrile?

There are three nitrogen atoms present in the structure of [2,2'-Bipyridine]-5-carbonitrile.

What is another name for [2,2'-Bipyridine]-5-carbonitrile?

Another name for [2,2'-Bipyridine]-5-carbonitrile is [2,2'-Bipyridine]-5-carbonitrile.

Please kindly note that our products and services are for research use only.