ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

2,2'-Bipyridine-4,4'-dicarboxamide

Catalog Number ACM100137028
CAS 100137-02-8
Structure {[CurrentData.Name]}
Synonyms 2-(4-Carbamoylpyridin-2-Yl)Pyridine-4-Carboxamide; 4,4'-Dicarbamoyl-2,2'-Bipyridine
IUPAC Name 2-(4-carbamoylpyridin-2-yl)pyridine-4-carboxamide
Molecular Weight 242.23
Molecular Formula C12H10N4O2
InChI ZWCNYHCXTYJJNJ-UHFFFAOYSA-N
InChI Key InChI=1S/C12H10N4O2/c13-11(17)7-1-3-15-9(5-7)10-6-8(12(14)18)2-4-16-10/h1-6H,(H2,13,17)(H2,14,18)
Purity 98%
Isomeric SMILES C1=CN=C(C=C1C(=O)N)C2=NC=CC(=C2)C(=O)N
Q&A

What is the chemical formula of 2,2'-Bipyridine-4,4'-dicarboxamide?

The chemical formula is C12H10N4O2.

What is the molecular weight of 2,2'-Bipyridine-4,4'-dicarboxamide?

The molecular weight is 242.23 g/mol.

What are some synonyms for 2,2'-Bipyridine-4,4'-dicarboxamide?

Some synonyms include 4,4'-Dicarbamoyl-2,2'-bipyridine and 2,2'-bipyridine-4,4'-bis(carboxamide).

What is the predicted boiling point of 2,2'-Bipyridine-4,4'-dicarboxamide?

The predicted boiling point is 524.2 ± 50.0 °C.

How should 2,2'-Bipyridine-4,4'-dicarboxamide be stored?

It should be stored in a refrigerator.

What is the predicted density of 2,2'-Bipyridine-4,4'-dicarboxamide?

The predicted density is 1.356 ± 0.06 g/cm3.

What is the predicted pKa value of 2,2'-Bipyridine-4,4'-dicarboxamide?

The predicted pKa value is 14.25 ± 0.50.

What is the CAS number of 2,2'-Bipyridine-4,4'-dicarboxamide?

The CAS number is 100137-02-8.

What is the molecular formula of 2,2'-Bipyridine-4,4'-dicarboxamide?

The molecular formula is C12H10N4O2.

How can 2,2'-Bipyridine-4,4'-dicarboxamide be represented in a chemical structure diagram?

It can be represented as C12H10N4O2.

Please kindly note that our products and services are for research use only.