ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

2,2'-Bipyridine-4,4'-dibutanoic acid

Catalog Number ACM447450808-1
CAS 447450-80-8
Synonyms 4,4'-([2,2'-Bipyridine]-4,4'-Diyl)Dibutanoic Acid; 4-[2-[4-(3-Carboxypropyl)pyridin-2-yl]pyridin-4-yl]butanoic acid
IUPAC Name 4-[2-[4-(3-carboxypropyl)pyridin-2-yl]pyridin-4-yl]butanoic acid
Molecular Weight 328.36
Molecular Formula C18H20N2O4
Canonical SMILES C1=CN=C(C=C1CCCC(=O)O)C2=NC=CC(=C2)CCCC(=O)O
InChI IFEOZDAYSOLALS-UHFFFAOYSA-N
InChI Key InChI=1S/C18H20N2O4/c21-17(22)5-1-3-13-7-9-19-15(11-13)16-12-14(8-10-20-16)4-2-6-18(23)24/h7-12H,1-6H2,(H,21,22)(H,23,24)
Purity 97%+
Exact Mass 328.14200
Isomeric SMILES C1=CN=C(C=C1CCCC(=O)O)C2=NC=CC(=C2)CCCC(=O)O
Q&A

What is the molecular weight of 2,2'-Bipyridine-4,4'-dibutanoic acid?

The molecular weight of 2,2'-Bipyridine-4,4'-dibutanoic acid is 328.36.

What are the synonyms for 2,2'-Bipyridine-4,4'-dibutanoic acid?

The synonyms for 2,2'-Bipyridine-4,4'-dibutanoic acid are 4,4'-([2,2'-Bipyridine]-4,4'-diyl)dibutanoic acid and 4-[2-[4-(3-carboxypropyl)pyridin-2-yl]pyridin-4-yl]butanoic acid.

What is the molecular formula of 2,2'-Bipyridine-4,4'-dibutanoic acid?

The molecular formula of 2,2'-Bipyridine-4,4'-dibutanoic acid is C18H20N2O4.

What is the predicted boiling point of 2,2'-Bipyridine-4,4'-dibutanoic acid?

The predicted boiling point of 2,2'-Bipyridine-4,4'-dibutanoic acid is 566.5±45.0 °C.

What is the predicted pka value of 2,2'-Bipyridine-4,4'-dibutanoic acid?

The predicted pka value of 2,2'-Bipyridine-4,4'-dibutanoic acid is 4.58±0.10.

What is the predicted density of 2,2'-Bipyridine-4,4'-dibutanoic acid?

The predicted density of 2,2'-Bipyridine-4,4'-dibutanoic acid is 1.252±0.06 g/cm3.

What is the CAS number for 2,2'-Bipyridine-4,4'-dibutanoic acid?

The CAS number for 2,2'-Bipyridine-4,4'-dibutanoic acid is 447450-80-8.

What functional groups are present in the structure of 2,2'-Bipyridine-4,4'-dibutanoic acid?

The structure contains a carboxylic acid group and a bipyridine group.

How many carbon atoms are present in the molecular formula of 2,2'-Bipyridine-4,4'-dibutanoic acid?

There are 18 carbon atoms present in the molecular formula of 2,2'-Bipyridine-4,4'-dibutanoic acid.

What is the IUPAC name for 2,2'-Bipyridine-4,4'-dibutanoic acid?

The IUPAC name for 2,2'-Bipyridine-4,4'-dibutanoic acid is 4-[2-[4-(3-carboxypropyl)pyridin-2-yl]pyridin-4-yl]butanoic acid.

Please kindly note that our products and services are for research use only.