2,2'-Bipyridine-4,4'-diamine

Catalog Number	ACM18511698-3
CAS	18511-69-8
Structure
Synonyms	4,4'-Diamino-2,2'-bipyridine; 4,4'-Diamino-2,2'-bipyridyl
IUPAC Name	2-(4-aminopyridin-2-yl)pyridin-4-amine
Molecular Weight	186.21
Molecular Formula	C10H10N4
Canonical SMILES	C1=CN=C(C=C1N)C2=NC=CC(=C2)N
InChI	WTHJTVKLMSJXEV-UHFFFAOYSA-N
InChI Key	InChI=1S/C10H10N4/c11-7-1-3-13-9(5-7)10-6-8(12)2-4-14-10/h1-6H,(H2,11,13)(H2,12,14)
Boiling Point	521.0±50.0 °C(Predicted)
Exact Mass	186.090546336
Heavy Atom Count	14
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	2
Monoisotopic Mass	186.090546336
Rotatable Bond Count	1
Topological Polar Surface Area	77.8 Ų

Q&A

What is the chemical formula of 2,2'-Bipyridine-4,4'-diamine?

The chemical formula is C10H10N4.

What are some synonyms for 2,2'-Bipyridine-4,4'-diamine?

Some synonyms include 4,4'-DIAMINO-2,2'-BIPYRIDINE, 2-(4-aminopyridin-2-yl)pyridin-4-amine, and 4,4'-DiaMino-2,2'-bipyridyl.

What is the molecular weight of 2,2'-Bipyridine-4,4'-diamine?

The molecular weight is 186.21 g/mol.

What is the melting point of 2,2'-Bipyridine-4,4'-diamine?

The melting point is greater than 270°C.

What is the predicted boiling point of 2,2'-Bipyridine-4,4'-diamine?

The predicted boiling point is 521.0±50.0 °C.

How is the solubility of 2,2'-Bipyridine-4,4'-diamine in DMSO and Methanol described?

It is described as slightly soluble in both DMSO and Methanol.

What is the predicted pka value of 2,2'-Bipyridine-4,4'-diamine?

The predicted pka value is 8.14±0.50.

What are some safety statements associated with the use of 2,2'-Bipyridine-4,4'-diamine?

Safety statements include "Keep in dark place, inert atmosphere, room temperature" and various other precautions.

What is the HS Code for 2,2'-Bipyridine-4,4'-diamine?

The HS Code is 29333990.

What is one of the uses of 2,2'-Bipyridine-4,4'-diamine?

It is used as a bidendate chelator.