[2,2'-Bipyridin]-3-amine

Catalog Number	ACM105166538-1
CAS	105166-53-8
Structure
Synonyms	2-P yridin-2-ylpyridin-3-amine
IUPAC Name	2-pyridin-2-ylpyridin-3-amine
Molecular Weight	171.20
Molecular Formula	C10H9N3
InChI	JQTIUAVTCSZFNT-UHFFFAOYSA-N
InChI Key	InChI=1S/C10H9N3/c11-8-4-3-7-13-10(8)9-5-1-2-6-12-9/h1-7H,11H2
Boiling Point	354.953 °C at 760 mmHg
Melting Point	122-123 ºC
Purity	95%+
Isomeric SMILES	C1=CC=NC(=C1)C2=C(C=CC=N2)N

Q&A

What is the molecular weight of [2,2'-Bipyridin]-3-amine?

The molecular weight of [2,2'-Bipyridin]-3-amine is 171.2.

What are some synonyms for [2,2'-Bipyridin]-3-amine?

Some synonyms for [2,2'-Bipyridin]-3-amine are 2-(Pyridin-2-yl)pyridin-3-amine and 3-Amino-2,2'-bipyridine.

What is the chemical formula for [2,2'-Bipyridin]-3-amine?

The chemical formula for [2,2'-Bipyridin]-3-amine is C10H9N3.

What is the melting point of [2,2'-Bipyridin]-3-amine?

The melting point of [2,2'-Bipyridin]-3-amine is 122-123 ºC.

What is the density of [2,2'-Bipyridin]-3-amine?

The density of [2,2'-Bipyridin]-3-amine is 1.193.

What is the predicted pka of [2,2'-Bipyridin]-3-amine?

The predicted pka of [2,2'-Bipyridin]-3-amine is 5.03±0.20.

What is the predicted boiling point of [2,2'-Bipyridin]-3-amine?

The predicted boiling point of [2,2'-Bipyridin]-3-amine is 355.0±27.0 °C.

How should [2,2'-Bipyridin]-3-amine be stored?

[2,2'-Bipyridin]-3-amine should be kept in a dark place, in an inert atmosphere, at room temperature.

What are some safety precautions to consider when handling [2,2'-Bipyridin]-3-amine?

When handling [2,2'-Bipyridin]-3-amine, it is important to wear appropriate personal protective equipment, avoid contact with skin and eyes, and work in a well-ventilated area.

In what type of environment should [2,2'-Bipyridin]-3-amine be stored to ensure its stability?

[2,2'-Bipyridin]-3-amine should be stored in an inert atmosphere to ensure its stability.