ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

2,2'-(6-Methoxy-[1,1'-biphenyl]-2,4'-diyl)bis(4,4-Dimethyl-4,5-dihydrooxazole)

Catalog Number ACM64957944
CAS 64957-94-4
Synonyms 2-[4-[2-(4,4-Dimethyl-5H-1,3-oxazol-2-yl)-6-methoxyphenyl]phenyl]-4,4-dimethyl-5H-1,3-oxazole
IUPAC Name 2-[4-[2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-6-methoxyphenyl]phenyl]-4,4-dimethyl-5H-1,3-oxazole
Molecular Weight 378.46
Molecular Formula C23H26N2O3
InChI BTHNJWTVMLBUHQ-UHFFFAOYSA-N
InChI Key InChI=1S/C23H26N2O3/c1-22(2)13-27-20(24-22)16-11-9-15(10-12-16)19-17(7-6-8-18(19)26-5)21-25-23(3,4)14-28-21/h6-12H,13-14H2,1-5H3
Purity 98%
Isomeric SMILES CC1(COC(=N1)C2=CC=C(C=C2)C3=C(C=CC=C3OC)C4=NC(CO4)(C)C)C
Q&A

What is the CAS number for the compound with 2,2'-(6-Methoxy-[1,1'-biphenyl]-2,4'-diyl)bis(4,4-Dimethyl-4,5-dihydrooxazole)?

The CAS number for the compound is 64957-94-4.

What is the molecular weight of the compound with 2,2'-(6-Methoxy-[1,1'-biphenyl]-2,4'-diyl)bis(4,4-Dimethyl-4,5-dihydrooxazole)?

The molecular weight of the compound is 378.46.

What is the product name of the compound with 2,2'-(6-Methoxy-[1,1'-biphenyl]-2,4'-diyl)bis(4,4-Dimethyl-4,5-dihydrooxazole)?

The product name is Oxazole, 2,2'-(6-methoxy[1,1'-biphenyl]-2,4'-diyl)bis[4,5-dihydro-4,4-dimethyl- (9CI).

Provide a synonym for the compound with 2,2'-(6-Methoxy-[1,1'-biphenyl]-2,4'-diyl)bis(4,4-Dimethyl-4,5-dihydrooxazole).

A synonym for the compound is 2,2'-(6-Methoxy-[1,1'-biphenyl]-2,4'-diyl)bis(4,4-Dimethyl-4,5-dihydrooxazole).

What is the molecular formula of the compound with 2,2'-(6-Methoxy-[1,1'-biphenyl]-2,4'-diyl)bis(4,4-Dimethyl-4,5-dihydrooxazole)?

The molecular formula is C23H26N2O3.

What is the melting point range of the compound?

The melting point range is 151-153 °C.

What is the predicted density of the compound?

The predicted density is 1.16±0.1 g/cm3.

What is the predicted boiling point of the compound?

The predicted boiling point is 503.0±50.0 °C.

What is the predicted pka of the compound?

The predicted pka is 4?+-.0.70.

Please kindly note that our products and services are for research use only.