2-(2,4-Difluorophenyl)pyridine

Catalog Number	ACM391604550-1
CAS	391604-55-0
Structure
Synonyms	Pyridine, 2-(2,4-Difluorophenyl)-
IUPAC Name	2-(2,4-difluorophenyl)pyridine
Molecular Weight	191.18
Molecular Formula	C11H7NF2
Canonical SMILES	C1=CC=NC(=C1)C2=C(C=C(C=C2)F)F
InChI	SSABEFIRGJISFH-UHFFFAOYSA-N
InChI Key	InChI=1S/C11H7F2N/c12-8-4-5-9(10(13)7-8)11-3-1-2-6-14-11/h1-7H
Melting Point	20 °C
Purity	97%
Appearance	Liqiud
Complexity	186
Covalently-Bonded Unit Count	1
Exact Mass	191.054656g/mol
Formal Charge	0
Heavy Atom Count	14
Isomeric SMILES	C1=CC=NC(=C1)C2=C(C=C(C=C2)F)F
Monoisotopic Mass	191.054656g/mol
Rotatable Bond Count	1

Q&A

What is the chemical formula of 2-(2,4-Difluorophenyl)pyridine?

The chemical formula of 2-(2,4-Difluorophenyl)pyridine is C11H7F2N.

What is the molecular weight of 2-(2,4-Difluorophenyl)pyridine?

The molecular weight of 2-(2,4-Difluorophenyl)pyridine is 191.18.

What are the product categories that 2-(2,4-Difluorophenyl)pyridine belongs to?

2-(2,4-Difluorophenyl)pyridine belongs to the Fluorine series and API intermediates product categories.

What is the physical form and color of 2-(2,4-Difluorophenyl)pyridine?

2-(2,4-Difluorophenyl)pyridine is a white crystal in form.

What is the boiling point of 2-(2,4-Difluorophenyl)pyridine?

The boiling point of 2-(2,4-Difluorophenyl)pyridine is 95°C/0.4 mmHg.

What is the safety hazard code associated with 2-(2,4-Difluorophenyl)pyridine?

The hazard code associated with 2-(2,4-Difluorophenyl)pyridine is Xn.

What are the safety statements related to the use of 2-(2,4-Difluorophenyl)pyridine?

The safety statements related to the use of 2-(2,4-Difluorophenyl)pyridine are 26-39-24/25.

What is the storage temperature recommended for 2-(2,4-Difluorophenyl)pyridine?

The recommended storage temperature for 2-(2,4-Difluorophenyl)pyridine is in an inert atmosphere at room temperature.

What is the predicted pKa value of 2-(2,4-Difluorophenyl)pyridine?

The predicted pKa value of 2-(2,4-Difluorophenyl)pyridine is 3.91±0.25.

What are some of the uses of 2-(2,4-Difluorophenyl)pyridine?

2-(2,4-Difluorophenyl)pyridine is used as a ligand in a blue-light emitting Ir(III) complexes suitable for use as phosphorescent OLEDs.