2,2'-(4,4'-Dimethyl-[1,1'-biphenyl]-2,2'-diyl)bis(4,5-dihydrooxazole)

Catalog Number	ACM1021602685
CAS	1021602-68-5
Synonyms	2,2'-Di(2-Oxazoline-2-Yl)-4,4'-Dimethylbiphenyl; 2-[2-[2-(4,5-Dihydro-1,3-oxazol-2-yl)-4-methylphenyl]-5-methylphenyl]-4,5-dihydro-1,3-oxazole
IUPAC Name	2-[2-[2-(4,5-dihydro-1,3-oxazol-2-yl)-4-methylphenyl]-5-methylphenyl]-4,5-dihydro-1,3-oxazole
Molecular Weight	320.39
Molecular Formula	C20H20N2O2
InChI	VCYLHPXEXNGKRA-UHFFFAOYSA-N
InChI Key	InChI=1S/C20H20N2O2/c1-13-3-5-15(17(11-13)19-21-7-9-23-19)16-6-4-14(2)12-18(16)20-22-8-10-24-20/h3-6,11-12H,7-10H2,1-2H3
Purity	98%
Isomeric SMILES	CC1=CC(=C(C=C1)C2=C(C=C(C=C2)C)C3=NCCO3)C4=NCCO4

Q&A

What is the CAS number of the compound containing 2,2'-(4,4'-Dimethyl-[1,1'-biphenyl]-2,2'-diyl)bis(4,5-dihydrooxazole)?

CAS number of the compound is 1021602-68-5.

What is the molecular weight of the compound?

The molecular weight of the compound is 320.39.

What is the product name of the compound containing 2,2'-(4,4'-Dimethyl-[1,1'-biphenyl]-2,2'-diyl)bis(4,5-dihydrooxazole)?

The product name is Oxazole, 2,2'-(4,4'-dimethyl[1,1'-biphenyl]-2,2'-diyl)bis[4,5-dihydro-.

What is the chemical formula of the compound?

The chemical formula is C20H20N2O2.

What is the melting point of the compound?

The melting point of the compound is 59.4-59.8 °C.

What is the predicted density of the compound?

The predicted density is 1.22±0.1 g/cm3.

What is the predicted boiling point of the compound?

The predicted boiling point is 532.4±50.0 °C.

What is the predicted pka value of the compound?

The predicted pka value is 4.79±0.50.

How many O atoms are present in the compound?

There are two O atoms present in the compound.

What is the systematic name of the compound?

2,2'-(4,4'-Dimethyl-[1,1'-biphenyl]-2,2'-diyl)bis(4,5-dihydrooxazole) is the systematic name of the compound.