ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

2,2,3,3,4,4,4-Heptafluorobutylamine

Catalog Number ACM374992-2
CAS 374-99-2
Structure {[CurrentData.Name]}
Synonyms 1H,1H-Heptafluorobutylamine; 2,2,3,3,4,4,4-heptafluorobutan-1-amine
IUPAC Name 2,2,3,3,4,4,4-heptafluorobutan-1-amine
Molecular Weight 197.05
Molecular Formula C4H4F7N
Canonical SMILES C(C(C(C(F)(F)F)(F)F)(F)F)N
InChI WBGBQSRNXPVFDB-UHFFFAOYSA-N
InChI Key InChI=1S/C4H4F7N/c5-2(6,1-12)3(7,8)4(9,10)11/h1,12H2
Boiling Point 70-71 °C
Flash Point 70-71 °C
Purity 97%
Density 1.493 g/cm3
Appearance Colorless liquid
EC Number 206-780-0
Exact Mass 199.02300
Isomeric SMILES C(C(C(C(F)(F)F)(F)F)(F)F)N
Packing Group II
pKa 5.89±0.30(Predicted)
Q&A

What is the molecular formula of 2,2,3,3,4,4,4-Heptafluorobutylamine?

The molecular formula is C4H4F7N.

What is the molecular weight of 2,2,3,3,4,4,4-Heptafluorobutylamine?

The molecular weight is 199.07 g/mol.

What is the IUPAC name of 2,2,3,3,4,4,4-Heptafluorobutylamine?

The IUPAC name is 2,2,3,3,4,4,4-heptafluorobutan-1-amine.

What is the InChI of 2,2,3,3,4,4,4-Heptafluorobutylamine?

The InChI is InChI=1S/C4H4F7N/c5-2(6,1-12)3(7,8)4(9,10)11/h1,12H2.

What is the InChIKey of 2,2,3,3,4,4,4-Heptafluorobutylamine?

The InChIKey is WBGBQSRNXPVFDB-UHFFFAOYSA-N.

What is the canonical SMILES of 2,2,3,3,4,4,4-Heptafluorobutylamine?

The canonical SMILES is C(C(C(C(F)(F)F)(F)F)(F)F)N.

What is the CAS number of 2,2,3,3,4,4,4-Heptafluorobutylamine?

The CAS number is 374-99-2.

What is the European Community (EC) number of 2,2,3,3,4,4,4-Heptafluorobutylamine?

The EC number is 206-780-0.

What is the DSSTox Substance ID of 2,2,3,3,4,4,4-Heptafluorobutylamine?

The DSSTox Substance ID is DTXSID10190840.

What is the molecular weight of 2,2,3,3,4,4,4-Heptafluorobutylamine according to PubChem?

The molecular weight is 199.07 g/mol (computed by PubChem).

Please kindly note that our products and services are for research use only.