2,2'-(2-Methyl-1,3-phenylene)bis(4,4-Dimethyl-4,5-dihydrooxazole)

Catalog Number	ACM64682399
CAS	64682-39-9
Synonyms	2-[3-(4,4-Dimethyl-5H-1,3-oxazol-2-yl)-2-methylphenyl]-4,4-dimethyl-5H-1,3-oxazole
IUPAC Name	2-[3-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-2-methylphenyl]-4,4-dimethyl-5H-1,3-oxazole
Molecular Weight	286.37
Molecular Formula	C17H22N2O2
InChI	CNVWQLLFBRDFTR-UHFFFAOYSA-N
InChI Key	InChI=1S/C17H22N2O2/c1-11-12(14-18-16(2,3)9-20-14)7-6-8-13(11)15-19-17(4,5)10-21-15/h6-8H,9-10H2,1-5H3
Purity	98%
Isomeric SMILES	CC1=C(C=CC=C1C2=NC(CO2)(C)C)C3=NC(CO3)(C)C

Q&A

What is the CAS number of the compound containing 2,2'-(2-Methyl-1,3-phenylene)bis(4,4-Dimethyl-4,5-dihydrooxazole)?

The CAS number of the compound is 64682-39-9.

What is the molecular weight of the compound with 2,2'-(2-Methyl-1,3-phenylene)bis(4,4-Dimethyl-4,5-dihydrooxazole)?

The molecular weight of the compound is 286.37.

What is the full product name of the compound?

The full product name is Oxazole, 2,2'-(2-methyl-1,3-phenylene)bis[4,5-dihydro-4,4-dimethyl-.

What are the synonyms of the compound?

The synonyms of the compound are Oxazole, 2,2'-(2-methyl-1,3-phenylene)bis[4,5-dihydro-4,4-dimethyl- and 2,2'-(2-Methyl-1,3-phenylene)bis(4,4-Dimethyl-4,5-dihydrooxazole).

What is the molecular formula of the compound?

The molecular formula of the compound is C17H22N2O2.

What is the melting point of the compound and in what solvent was it measured?

The melting point of the compound is 80-82 °C and it was measured in hexane.

What is the predicted density of the compound?

The predicted density of the compound is 1.14±0.1 g/cm3.

What is the predicted boiling point of the compound?

The predicted boiling point of the compound is 418.4±45.0 °C.

What is the predicted pKa value of the compound?

The predicted pKa value of the compound is 4.87±0.70.

How is the chemical structure of the compound described with 2,2'-(2-Methyl-1,3-phenylene)bis(4,4-Dimethyl-4,5-dihydrooxazole)?

The chemical structure of the compound is described as having 2,2'-(2-Methyl-1,3-phenylene)bis(4,4-Dimethyl-4,5-dihydrooxazole).