ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

2,2'-((1S,2S)-1,2-Diaminoethane-1,2-diyl)diphenol

Catalog Number ACM870991687-1
CAS 870991-68-7
Synonyms (1S,2S)-1,2-Bis(2-hydroxyphenyl)ethylenediamine
IUPAC Name 2-[(1S,2S)-1,2-diamino-2-(2-hydroxyphenyl)ethyl]phenol
Molecular Weight 244.29
Molecular Formula C14H16N2O2
Canonical SMILES C1=CC=C(C(=C1)C(C(C2=CC=CC=C2O)N)N)O
InChI MRNPLGLZBUDMRE-KBPBESRZSA-N
InChI Key InChI=1S/C14H16N2O2/c15-13(9-5-1-3-7-11(9)17)14(16)10-6-2-4-8-12(10)18/h1-8,13-14,17-18H,15-16H2/t13-,14-/m0/s1
Melting Point 159 °C(dec.)
Purity 97%
Exact Mass 244.121177757
Heavy Atom Count 18
Hydrogen Bond Acceptor Count 4
Hydrogen Bond Donor Count 4
Isomeric SMILES C1=CC=C(C(=C1)[C@@H]([C@H](C2=CC=CC=C2O)N)N)O
Monoisotopic Mass 244.121177757
Rotatable Bond Count 3
Topological Polar Surface Area 92.5 Ų
Q&A

What is the molecular weight of 2,2'-((1S,2S)-1,2-Diaminoethane-1,2-diyl)diphenol?

The molecular weight of 2,2'-((1S,2S)-1,2-Diaminoethane-1,2-diyl)diphenol is 244.29.

What is the product name of 2,2'-((1S,2S)-1,2-Diaminoethane-1,2-diyl)diphenol?

The product name of 2,2'-((1S,2S)-1,2-Diaminoethane-1,2-diyl)diphenol is (1S,2S)-1,2-Bis(2-hydroxyphenyl)ethylenediamine.

In what form does 2,2'-((1S,2S)-1,2-Diaminoethane-1,2-diyl)diphenol exist?

The compound exists in powder to crystal form.

What is the solubility of 2,2'-((1S,2S)-1,2-Diaminoethane-1,2-diyl)diphenol?

The compound is slightly soluble in Chloroform.

What is the color of 2,2'-((1S,2S)-1,2-Diaminoethane-1,2-diyl)diphenol?

The compound can be white, light yellow, or light orange in color.

What is the HS Code for 2,2'-((1S,2S)-1,2-Diaminoethane-1,2-diyl)diphenol?

The HS Code for 2,2'-((1S,2S)-1,2-Diaminoethane-1,2-diyl)diphenol is 2922.19.7000.

What are some synonyms for 2,2'-((1S,2S)-1,2-Diaminoethane-1,2-diyl)diphenol?

Some synonyms for 2,2'-((1S,2S)-1,2-Diaminoethane-1,2-diyl)diphenol are 2,2-[(1S,2S)-1,2-Diamino-1,2-ethanediyl]bisphenol, and (1S,2S)-1,2-Diamino-1,2-bis(2-hydroxyphenyl)ethane.

What is the melting point of 2,2'-((1S,2S)-1,2-Diaminoethane-1,2-diyl)diphenol?

The melting point of 2,2'-((1S,2S)-1,2-Diaminoethane-1,2-diyl)diphenol is 159 °C (dec.).

What is the chemical formula (MF) for 2,2'-((1S,2S)-1,2-Diaminoethane-1,2-diyl)diphenol?

The chemical formula (MF) for 2,2'-((1S,2S)-1,2-Diaminoethane-1,2-diyl)diphenol is C14H16N2O2.

What are some uses of 2,2'-((1S,2S)-1,2-Diaminoethane-1,2-diyl)diphenol?

The compound is a useful synthetic compound.

Please kindly note that our products and services are for research use only.