2,2'-(1H-Pyrazole-3,5-diyl)dipyridine

Catalog Number	ACM129485832-1
CAS	129485-83-2
Structure
Synonyms	3,5-Di(2-pyridyl)pyrazole; 2-(3-Pyridin-2-yl-1H-pyrazol-5-yl)pyridine
IUPAC Name	2-(3-pyridin-2-yl-1H-pyrazol-5-yl)pyridine
Molecular Weight	222.25
Molecular Formula	C13H10N4
Canonical SMILES	C1=CC=NC(=C1)C2=CC(=NN2)C3=CC=CC=N3
InChI	IMDRKCUYKQQEAC-UHFFFAOYSA-N
InChI Key	InChI=1S/C13H10N4/c1-3-7-14-10(5-1)12-9-13(17-16-12)11-6-2-4-8-15-11/h1-9H,(H,16,17)
Boiling Point	476.5±35.0 °C(Predicted)
Melting Point	188 °C
Purity	98%
Exact Mass	222.090546336
Heavy Atom Count	17
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	1
Monoisotopic Mass	222.090546336
Rotatable Bond Count	2
Topological Polar Surface Area	54.5 Ų

Q&A

What is the CAS number for 3,5-DI(2-PYRIDYL)PYRAZOLE?

The CAS number for 3,5-DI(2-PYRIDYL)PYRAZOLE is 129485-83-2.

What is the molecular weight of 3,5-DI(2-PYRIDYL)PYRAZOLE?

The molecular weight of 3,5-DI(2-PYRIDYL)PYRAZOLE is 222.25.

What are some synonyms for 3,5-DI(2-PYRIDYL)PYRAZOLE?

Some synonyms for 3,5-DI(2-PYRIDYL)PYRAZOLE are Dipyridylpyrazole and 2,2'-(1H-Pyrazole-3,5-diyl)dipyridine.

What is the melting point of 3,5-DI(2-PYRIDYL)PYRAZOLE?

The melting point of 3,5-DI(2-PYRIDYL)PYRAZOLE is 188 °C.

What is the predicted density of 3,5-DI(2-PYRIDYL)PYRAZOLE?

The predicted density of 3,5-DI(2-PYRIDYL)PYRAZOLE is 1.248±0.06 g/cm3.

In what solvent is 3,5-DI(2-PYRIDYL)PYRAZOLE almost transparent when hot?

3,5-DI(2-PYRIDYL)PYRAZOLE is almost transparent in hot Methanol.

What is the predicted pka value of 3,5-DI(2-PYRIDYL)PYRAZOLE?

The predicted pka value of 3,5-DI(2-PYRIDYL)PYRAZOLE is 9.96±0.19.

What is the predicted boiling point of 3,5-DI(2-PYRIDYL)PYRAZOLE?

The predicted boiling point of 3,5-DI(2-PYRIDYL)PYRAZOLE is 476.5±35.0 °C.

How should 3,5-DI(2-PYRIDYL)PYRAZOLE be stored?

3,5-DI(2-PYRIDYL)PYRAZOLE should be stored under inert gas (nitrogen or argon) at 2-8°C.

What is the form and color of 3,5-DI(2-PYRIDYL)PYRAZOLE?

The form of 3,5-DI(2-PYRIDYL)PYRAZOLE is powder to crystal, and the color is white to light yellow.