2-(1H-1,2,4-Triazol-3-yl)pyridine

Catalog Number	ACM23195622-2
CAS	23195-62-2
Structure
Synonyms	2-(2H-1,2,4-Triazol-3-yl)pyridine;3-(Pyridin-2-yl)-1,2,4-triazole
IUPAC Name	2-(1H-1,2,4-triazol-5-yl)pyridine
Molecular Weight	146.14
Molecular Formula	C7H6N4
Canonical SMILES	C1=CC=NC(=C1)C2=NC=NN2
InChI	PVMLJDLTWMGZAH-UHFFFAOYSA-N
InChI Key	InChI=1S/C7H6N4/c1-2-4-8-6(3-1)7-9-5-10-11-7/h1-5H,(H,9,10,11)
Boiling Point	157-162 °C
Melting Point	157-162 °C
Purity	98%
Appearance	Light yellow solid
Application	This product is suitable for scientific research.
Storage	room temp
Complexity	128
Covalently-Bonded Unit Count	1
Exact Mass	146.059246208
Heavy Atom Count	11
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	1
MDL Number	MFCD20502741
Monoisotopic Mass	146.059246208
PubChem ID	329765944
Rotatable Bond Count	1
Topological Polar Surface Area	54.5 Ų

Q&A

What is the product name of the compound with the cas number 23195-62-2?

The product name is 2-(1H-1,2,4-Triazol-3-yl)pyridine.

What is the molecular weight of 2-(1H-1,2,4-Triazol-3-yl)pyridine?

The molecular weight is 146.14.

What is the molecular formula of 2-(1H-1,2,4-Triazol-3-yl)pyridine?

The molecular formula is C7H6N4.

What is the appearance of 2-(1H-1,2,4-Triazol-3-yl)pyridine?

It has a light yellow solid appearance.

What is the application of 2-(1H-1,2,4-Triazol-3-yl)pyridine?

This product is suitable for scientific research.

What is the purity level of 2-(1H-1,2,4-Triazol-3-yl)pyridine?

The purity level is 98%.

What is the boiling point and melting point of 2-(1H-1,2,4-Triazol-3-yl)pyridine?

The boiling point is 157-162 °C and the melting point is also 157-162 °C.

What is the storage recommendation for 2-(1H-1,2,4-Triazol-3-yl)pyridine?

It should be stored at room temperature.

What are the features and benefits of 2-(1H-1,2,4-Triazol-3-yl)pyridine?

The features and benefits include high quality products, fast delivery, and the ability to order additional products.

What is the packaging size for 2-(1H-1,2,4-Triazol-3-yl)pyridine?

It is packaged in 5 g in a glass bottle.