(1S,2S)-N1,N2-Dibenzylcyclohexane-1,2-diamine

Catalog Number	ACM191480612
CAS	191480-61-2
Structure
Synonyms	(1S,2S)-1-N,2-N-Dibenzylcyclohexane-1,2-Diamine; 1S,2S-N,N'-Bis(Phenylmethyl)-1,2-Cyclohexanediamine
IUPAC Name	(1S,2S)-1-N,2-N-dibenzylcyclohexane-1,2-diamine
Molecular Weight	294.43
Molecular Formula	C20H26N2
InChI	SJBYIGXWWGSEES-PMACEKPBSA-N
InChI Key	InChI=1S/C20H26N2/c1-3-9-17(10-4-1)15-21-19-13-7-8-14-20(19)22-16-18-11-5-2-6-12-18/h1-6,9-12,19-22H,7-8,13-16H2/t19-,20-/m0/s1
Boiling Point	436.3±40.0 °C(Predicted)
Purity	97%
Isomeric SMILES	C1CC[C@@H]([C@H](C1)NCC2=CC=CC=C2)NCC3=CC=CC=C3

Q&A

What is the CAS number of the compound (1S,2S)-N1,N2-Dibenzylcyclohexane-1,2-diamine?

The CAS number is 191480-61-2.

What is the molecular weight of (1S,2S)-N1,N2-Dibenzylcyclohexane-1,2-diamine?

The molecular weight is 294.43.

What are some synonyms of (1S,2S)-N1,N2-Dibenzylcyclohexane-1,2-diamine?

Some synonyms include (1S,2S)-N,N'-Dibenzyl-1,2-cyclohexanediamine, (1S,2S)-N1,N2-Dibenzylcyclohexane-1,2-diamine, and 1S,2S-N,N'-bis(phenylMethyl)-1,2-CyclohexanediaMine.

What is the molecular formula of (1S,2S)-N1,N2-Dibenzylcyclohexane-1,2-diamine?

The molecular formula is C20H26N2.

What is the predicted boiling point of (1S,2S)-N1,N2-Dibenzylcyclohexane-1,2-diamine?

The predicted boiling point is 436.3±40.0 °C.

What is the predicted pKa of (1S,2S)-N1,N2-Dibenzylcyclohexane-1,2-diamine?

The predicted pKa is 9.85±0.40.

What is the predicted density of (1S,2S)-N1,N2-Dibenzylcyclohexane-1,2-diamine?

The predicted density is 1.05±0.1 g/cm3.

How is the compound (1S,2S)-N1,N2-Dibenzylcyclohexane-1,2-diamine predicted to behave in terms of acidity?

It is predicted to have a pKa of 9.85±0.40, indicating it may act as a weak base.

What is the significance of the stereochemistry denoted by (1S,2S) in the compound's name?

The stereochemistry (1S,2S) indicates the absolute configuration of the compound's chiral centers, specifying the orientation of the substituents in space.

What is the potential application for (1S,2S)-N1,N2-Dibenzylcyclohexane-1,2-diamine based on its chemical properties?

Based on its structure and predicted properties, (1S,2S)-N1,N2-Dibenzylcyclohexane-1,2-diamine could potentially be used as a chiral ligand in asymmetric catalysis.