(1S,2S)-N1,N1,N2-Trimethylcyclohexane-1,2-diamine

Catalog Number	ACM1067631360
CAS	1067631-36-0
Synonyms	(1S,2S)-1-N,2-N,2-N-Trimethylcyclohexane-1,2-diamine
IUPAC Name	(1S,2S)-1-N,2-N,2-N-trimethylcyclohexane-1,2-diamine
Molecular Weight	156.27
Molecular Formula	C9H20N2
InChI	MGFSHCOCJMZNSV-IUCAKERBSA-N
InChI Key	InChI=1S/C9H20N2/c1-10-8-6-4-5-7-9(8)11(2)3/h8-10H,4-7H2,1-3H3/t8-,9-/m0/s1
Boiling Point	200.3±8.0 °C(Predicted)
Purity	97%
Isomeric SMILES	CN[C@H]1CCCC[C@@H]1N(C)C

Q&A

What is the molecular weight of (1S,2S)-N,N,N'-triMethyl-1,2-diaMinocyclohexane?

The molecular weight is 156.27.

What are the synonyms for (1S,2S)-N,N,N'-triMethyl-1,2-diaMinocyclohexane?

Some synonyms include (1S,2S)-N,N,N`-Trimethylcyclohexane-1,2-diamine and N,N',N'-trimethyl-(1S,2S)-cyclohexane-1,2-diamine.

What is the boiling point of (1S,2S)-N,N,N'-triMethyl-1,2-diaMinocyclohexane?

The boiling point is predicted to be 200.3±8.0 °C.

How should (1S,2S)-N,N,N'-triMethyl-1,2-diaMinocyclohexane be stored?

It should be stored under inert gas (nitrogen or Argon) at 2-8 °C.

What is the predicted density of (1S,2S)-N,N,N'-triMethyl-1,2-diaMinocyclohexane?

The predicted density is 0.89±0.1 g/cm3.

What is the predicted pKa value of (1S,2S)-N,N,N'-triMethyl-1,2-diaMinocyclohexane?

The predicted pKa value is 10.65±0.40.

What is the chemical formula of (1S,2S)-N,N,N'-triMethyl-1,2-diaMinocyclohexane?

The chemical formula is C9H20N2.

How can (1S,2S)-N,N,N'-triMethyl-1,2-diaMinocyclohexane be represented in shorthand?

It can be represented as (1S,2S)-N1,N1,N2-Trimethylcyclohexane-1,2-diamine.

What is the predicted boiling point of (1S,2S)-N,N,N'-triMethyl-1,2-diaMinocyclohexane?

The predicted boiling point is 200.3±8.0 °C.

Why is it recommended to store (1S,2S)-N,N,N'-triMethyl-1,2-diaMinocyclohexane under inert gas?

It is recommended to prevent oxidation or degradation of the compound.