(1S,2S)-N1,N1-Dimethylcyclohexane-1,2-diamine

Catalog Number	ACM894493959-1
CAS	894493-95-9
Structure
Synonyms	(1S,2S)-2-N,2-N-Dimethylcyclohexane-1,2-diamine
IUPAC Name	(1S,2S)-2-N,2-N-dimethylcyclohexane-1,2-diamine
Molecular Weight	142.24
Molecular Formula	C8H18N2
InChI	FRDZGSBXKJXGNR-YUMQZZPRSA-N
InChI Key	InChI=1S/C8H18N2/c1-10(2)8-6-4-3-5-7(8)9/h7-8H,3-6,9H2,1-2H3/t7-,8-/m0/s1
Boiling Point	180 °C
Purity	98%+
Appearance	Colourless liquid
Isomeric SMILES	CN(C)[C@H]1CCCC[C@@H]1N

Q&A

What is the molecular weight of (1S,2S)-N,N-Dimethylcyclohexane-1,2-diamine?

The molecular weight is 142.24.

What are some synonyms for (1S,2S)-N,N-Dimethylcyclohexane-1,2-diamine?

Some synonyms include (1S,2S)-(+)-N,N-Dimethyl diaminocyclohexane, (1S,2S)-N1,N1-Dimethylcyclohexane-1,2-diamine, and (1S,2S)-N1,N1-Dimethyl-1,2-cyclohexanediamine.

What is the boiling point of (1S,2S)-N,N-Dimethylcyclohexane-1,2-diamine?

The boiling point is 180°C.

What is the density of (1S,2S)-N,N-Dimethylcyclohexane-1,2-diamine?

The density is 0.92.

How should (1S,2S)-N,N-Dimethylcyclohexane-1,2-diamine be stored?

It should be stored under inert gas (nitrogen or Argon) at 2-8°C.

What are some of the risk and safety statements associated with (1S,2S)-N,N-Dimethylcyclohexane-1,2-diamine?

Risk Statements: 22-34; Safety Statements: 26-36/37/39-45.

What is the Hazard Class of (1S,2S)-N,N-Dimethylcyclohexane-1,2-diamine?

The Hazard Class is 8.

What is the HS Code for (1S,2S)-N,N-Dimethylcyclohexane-1,2-diamine?

The HS Code is 29130000.

What is the chemical property of (1S,2S)-N,N-Dimethylcyclohexane-1,2-diamine?

It is a colorless liquid.

What is the molecular formula of (1S,2S)-N,N-Dimethylcyclohexane-1,2-diamine?

The molecular formula is C8H18N2.