(1S,2S)-N,N'-Dimethylcyclohexane-1,2-diamine

Catalog Number	ACM87583899-1
CAS	87583-89-9
Structure
Synonyms	(1S,2S)-N,N'-Dimethyl-1,2-cyclohexanediamine; trans-(1S,2S)-N,N'-Dimethylcyclohexane-1,2-diamine
IUPAC Name	(1S,2S)-1-N,2-N-dimethylcyclohexane-1,2-diamine
Molecular Weight	142.24
Molecular Formula	C8H18N2
Canonical SMILES	CNC1CCCCC1NC
InChI	JRHPOFJADXHYBR-YUMQZZPRSA-N
InChI Key	InChI=1S/C8H18N2/c1-9-7-5-3-4-6-8(7)10-2/h7-10H,3-6H2,1-2H3/t7-,8-/m0/s1
Boiling Point	186.8 °C at 760 mmHg
Melting Point	39-44 °C
Purity	97%
Appearance	Pale brown solid
Exact Mass	142.146998583
Heavy Atom Count	10
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	2
Isomeric SMILES	CN[C@H]1CCCC[C@@H]1NC
Monoisotopic Mass	142.146998583
Rotatable Bond Count	2
Topological Polar Surface Area	24.1 Ų

Q&A

What is the CAS number for (1S,2S)-N,N'-Dimethylcyclohexane-1,2-diamine?

The CAS number is 87583-89-9.

What is the molecular weight of (1S,2S)-N,N'-Dimethylcyclohexane-1,2-diamine?

The molecular weight is 142.24.

What are some product categories that (1S,2S)-N,N'-Dimethylcyclohexane-1,2-diamine belongs to?

Chiral Nitrogen, DACH&Trost Series, API intermediates, Amines (Chiral), Analytical Chemistry, Isoquinolines, Quinolines, Quinaldines, Chiral Building Blocks, e.e. / Absolute Configuration Determination (NMR), Enantiomer Excess & Absolute Configuration Determination, Synthetic Organic Chemistry.

What is the melting point range of (1S,2S)-N,N'-Dimethylcyclohexane-1,2-diamine?

The melting point range is 39-44 °C.

What is the predicted boiling point of (1S,2S)-N,N'-Dimethylcyclohexane-1,2-diamine?

The predicted boiling point is 186.8±8.0 °C.

What is the refractive index of (1S,2S)-N,N'-Dimethylcyclohexane-1,2-diamine in CHCl3?

The refractive index is 145 ° (C=4, CHCl3).

What is the optical activity of (1S,2S)-N,N'-Dimethylcyclohexane-1,2-diamine in chloroform?

The optical activity is [α]/D +145±5°, c = 4.47 in chloroform.

How is (1S,2S)-N,N'-Dimethylcyclohexane-1,2-diamine stored?

It is stored at 2-8°C.

What is the water solubility of (1S,2S)-N,N'-Dimethylcyclohexane-1,2-diamine?

It is slightly soluble in water.

What are some of the uses of (1S,2S)-N,N'-Dimethylcyclohexane-1,2-diamine?

The compound can be used to synthesize derivatives of α-diazophosphonic acid, as a starting material for the synthesis of α-chloro-α-alkylphosphonic acids, and to prepare C2 symmetrical diamine enantiomers of C60 with chirospectrosopic properties. It is also employed in the synthesis of 6-substituted 1-oxoindanoyl isoleucine conjugates and modeling studies with the coi1-jaz co-receptor complex of lima bean.