(1S,2S)-N',N'-Dimethyl-1,2-diphenyl-1,2-ethanediamine

Catalog Number	ACM344402875
CAS	344402-87-5
Structure
Synonyms	1,2-Ethanediamine, N1,N1-dimethyl-1,2-diphenyl-, (1S,2S)-
IUPAC Name	(1S,2S)-N',N'-dimethyl-1,2-diphenylethane-1,2-diamine
Molecular Weight	240.35
Molecular Formula	C16H20N2
InChI	OEDXASUOCKHCRL-HOTGVXAUSA-N
InChI Key	InChI=1S/C16H20N2/c1-18(2)16(14-11-7-4-8-12-14)15(17)13-9-5-3-6-10-13/h3-12,15-16H,17H2,1-2H3/t15-,16-/m0/s1
Purity	97%
Appearance	White or yellow powder
Isomeric SMILES	CN(C)[C@@H](C1=CC=CC=C1)[C@H](C2=CC=CC=C2)N

Q&A

What is the chemical formula for (1S,2S)-N',N'-Dimethyl-1,2-diphenyl-1,2-ethanediamine?

The chemical formula is C16H20N2.

What is the molecular weight of (1S,2S)-N',N'-Dimethyl-1,2-diphenyl-1,2-ethanediamine?

The molecular weight is 240.34 g/mol.

What are some synonyms for (1S,2S)-N',N'-Dimethyl-1,2-diphenyl-1,2-ethanediamine?

Some synonyms include 1,2-Ethanediamine, N1,N1-dimethyl-1,2-diphenyl-, (1S,2S)- and (1S,2S)-N1,N1-Dimethyl-1,2-diphenylethane-1,2-diamine.

What is the predicted boiling point of (1S,2S)-N',N'-Dimethyl-1,2-diphenyl-1,2-ethanediamine?

The predicted boiling point is 323.2 ± 30.0 °C.

What is the predicted pKa value for (1S,2S)-N',N'-Dimethyl-1,2-diphenyl-1,2-ethanediamine?

The predicted pKa value is 9.62 ± 0.10.

What is the predicted density of (1S,2S)-N',N'-Dimethyl-1,2-diphenyl-1,2-ethanediamine?

The predicted density is 1.052 ± 0.06 g/cm3.

What is the CAS number for (1S,2S)-N',N'-Dimethyl-1,2-diphenyl-1,2-ethanediamine?

The CAS number is 344402-87-5.

What is the percentage of enantiomeric excess for (1S,2S)-N',N'-Dimethyl-1,2-diphenyl-1,2-ethanediamine?

The enantiomeric excess is 99%.