(1S,2S)-Cyclohexane-1,2-diamine dihydrochloride

Catalog Number	ACM35018623-1
CAS	35018-62-3
Structure
Synonyms	(1S-trans)-1,2-Cyclohexanediamine dihydrochloride
IUPAC Name	(1S,2S)-cyclohexane-1,2-diamine;dihydrochloride
Molecular Weight	187.11
Molecular Formula	C6H16Cl2N2
InChI	HEKOZXSZLOBKGM-USPAICOZSA-N
InChI Key	InChI=1S/C6H14N2.2ClH/c7-5-3-1-2-4-6(5)8;;/h5-6H,1-4,7-8H2;2*1H/t5-,6-;;/m0../s1
Purity	98%+
Isomeric SMILES	C1CC[C@@H]([C@H](C1)N)N.Cl.Cl

Q&A

What is the CAS number for (1S-trans)-1,2-Cyclohexanediamine dihydrochloride?

The CAS number is 35018-62-3.

What is the molecular weight of (1S-trans)-1,2-Cyclohexanediamine dihydrochloride?

The molecular weight is 187.

What is another name for (1S,2S)-1,2-Cyclohexanediamine hydrochloride?

Another name is (1S,2S)-Cyclohexane-1,2-diamine dihydrochloride.

What are some synonyms for (1S-trans)-1,2-Cyclohexanediamine dihydrochloride?

Synonyms include 1,2-Cyclohexanediamine hydrochloride and (1S,2S)-1,2-Cyclohexanediaminehydrochloride(1:1).

What is the molecular formula of (1S-trans)-1,2-Cyclohexanediamine dihydrochloride?

The molecular formula is C6H14N2.2(HCl).

What is the molecular structure of (1S-trans)-1,2-Cyclohexanediamine dihydrochloride?

The molecular structure is that of a cyclohexane ring with two amine functional groups on adjacent carbons.

How many nitrogen atoms are present in the molecule?

There are two nitrogen atoms present.

What is the stereochemistry of the molecule?

The stereochemistry is (1S,2S), indicating the configuration of the chiral centers in the molecule.

What is the ratio of the hydrochloride ions to the (1,2-Cyclohexanediamine) molecule?

The ratio is 2:1, as indicated by the formula C6H14N2.2(HCl).

Can (1S-trans)-1,2-Cyclohexanediamine dihydrochloride be used as a reagent in organic synthesis?

Yes, (1S-trans)-1,2-Cyclohexanediamine dihydrochloride can be used as a reagent in some organic synthesis reactions.