(1S,2S)-2-(Piperidin-1-yl)cyclohexanamine

Catalog Number	ACM824938989
CAS	824938-98-9
Structure
Synonyms	(1S,2S)-2-Piperidin-1-ylcyclohexan-1-amine
IUPAC Name	(1S,2S)-2-piperidin-1-ylcyclohexan-1-amine
Molecular Weight	182.31
Molecular Formula	C11H22N2
InChI	QHFKXCGYRHKLNG-QWRGUYRKSA-N
InChI Key	InChI=1S/C11H22N2/c12-10-6-2-3-7-11(10)13-8-4-1-5-9-13/h10-11H,1-9,12H2/t10-,11-/m0/s1
Purity	97%
Isomeric SMILES	C1CCN(CC1)[C@H]2CCCC[C@@H]2N

Q&A

What is the CAS number of (1S,2S)-2-(Piperidin-1-yl)cyclohexanamine?

CAS: 824938-98-9

What is the molecular weight of (1S,2S)-2-(Piperidin-1-yl)cyclohexanamine?

MW: 182.31

What is the product name of (1S,2S)-2-(Piperidin-1-yl)cyclohexanamine?

(1S,2S)-trans-2-(1-Piperidinyl) cyclohexylaMine

What are some synonyms of (1S,2S)-2-(Piperidin-1-yl)cyclohexanamine?

(1S,2S)-2-(1-Piperidinyl)cyclohexanamine
(1S,2S)-2-(Piperidin-1-yl)cyclohexanamine

What is the molecular formula of (1S,2S)-2-(Piperidin-1-yl)cyclohexanamine?

MF: C11H22N2

What is the predicted boiling point of (1S,2S)-2-(Piperidin-1-yl)cyclohexanamine?

Boiling point: 247.1±8.0 °C (Predicted)

What is the predicted pKa of (1S,2S)-2-(Piperidin-1-yl)cyclohexanamine?

pKa: 11.02±0.70 (Predicted)

What is the predicted density of (1S,2S)-2-(Piperidin-1-yl)cyclohexanamine?

Density: 0.984±0.06 g/cm3 (Predicted)

In what form is (1S,2S)-2-(Piperidin-1-yl)cyclohexanamine predicted to exist at room temperature (solid, liquid, gas)?

Based on the predicted boiling point, (1S,2S)-2-(Piperidin-1-yl)cyclohexanamine is likely to be a liquid at room temperature.

How many nitrogen atoms are present in the molecular formula of (1S,2S)-2-(Piperidin-1-yl)cyclohexanamine?

There are 2 nitrogen atoms in the molecular formula of (1S,2S)-2-(Piperidin-1-yl)cyclohexanamine.