(1S,2S)-1,2-Dimesitylethane-1,2-diamine

Catalog Number	ACM186769186-1
CAS	186769-18-6
Structure
Synonyms	(1S,2S)-1,2-Bis(2,4,6-trimethylphenyl)ethylenediamine
IUPAC Name	(1S,2S)-1,2-bis(2,4,6-trimethylphenyl)ethane-1,2-diamine
Molecular Weight	296.45
Molecular Formula	C20H28N2
Canonical SMILES	CC1=CC(=C(C(=C1)C)C(C(C2=C(C=C(C=C2C)C)C)N)N)C
InChI	ILMRHFMYIXTNMC-PMACEKPBSA-N
InChI Key	InChI=1S/C20H28N2/c1-11-7-13(3)17(14(4)8-11)19(21)20(22)18-15(5)9-12(2)10-16(18)6/h7-10,19-20H,21-22H2,1-6H3/t19-,20-/m0/s1
Melting Point	>300 °C
Purity	98%
Exact Mass	296.225248902
Heavy Atom Count	22
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	2
Isomeric SMILES	CC1=CC(=C(C(=C1)C)[C@@H]([C@H](C2=C(C=C(C=C2C)C)C)N)N)C
Monoisotopic Mass	296.225248902
Rotatable Bond Count	3
Topological Polar Surface Area	52 Ų

Q&A

What is the chemical formula of (1S,2S)-1,2-Dimesitylethane-1,2-diamine?

The chemical formula of (1S,2S)-1,2-Dimesitylethane-1,2-diamine is C20H28N2.

What is the molecular weight of (1S,2S)-1,2-Dimesitylethane-1,2-diamine?

The molecular weight of (1S,2S)-1,2-Dimesitylethane-1,2-diamine is 296.45.

What is the CAS number of (1S,2S)-1,2-Dimesitylethane-1,2-diamine?

The CAS number of (1S,2S)-1,2-Dimesitylethane-1,2-diamine is 186769-18-6.

What is the melting point of (1S,2S)-1,2-Dimesitylethane-1,2-diamine?

The melting point of (1S,2S)-1,2-Dimesitylethane-1,2-diamine is greater than 300 °C.

What is the boiling point of (1S,2S)-1,2-Dimesitylethane-1,2-diamine?

The boiling point of (1S,2S)-1,2-Dimesitylethane-1,2-diamine is predicted to be 451.7 ± 40.0 °C.

What is the solubility of (1S,2S)-1,2-Dimesitylethane-1,2-diamine?

The compound is slightly soluble in dichloromethane.

What is the appearance of (1S,2S)-1,2-Dimesitylethane-1,2-diamine?

The compound appears as a white to almost white powder to crystal.

What is the predicted pKa value of (1S,2S)-1,2-Dimesitylethane-1,2-diamine?

The predicted pKa value of (1S,2S)-1,2-Dimesitylethane-1,2-diamine is 10.43 ± 0.10.

What is the optical activity of (1S,2S)-1,2-Dimesitylethane-1,2-diamine?

The optical activity of (1S,2S)-1,2-Dimesitylethane-1,2-diamine is [α]20/D 129°, c = 1 in H2O.

In which product categories does (1S,2S)-1,2-Dimesitylethane-1,2-diamine belong?

The compound belongs to the product categories of Amines (Chiral), Chiral Building Blocks, and Synthetic Organic Chemistry.