(1S,2S)-1,2-Bis(4-nitrophenyl)ethane-1,2-diamine dihydrochloride

Catalog Number	ACM1052707079
CAS	1052707-07-9
Structure
Synonyms	(1S, 2S)-1,2-Bis(4-nitrophenyl)ethylenediamine dihydrochloride
IUPAC Name	(1S,2S)-1,2-bis(4-nitrophenyl)ethane-1,2-diamine;dihydrochloride
Molecular Weight	375.21
Molecular Formula	C14H16Cl2N4O4
InChI	PDPYGNJVCKPVGM-AXEKQOJOSA-N
InChI Key	InChI=1S/C14H14N4O4.2ClH/c15-13(9-1-5-11(6-2-9)17(19)20)14(16)10-3-7-12(8-4-10)18(21)22;;/h1-8,13-14H,15-16H2;2*1H/t13-,14-;;/m0../s1
Melting Point	202-207 °C
Purity	97%
Appearance	White powder
Isomeric SMILES	C1=CC(=CC=C1[C@@H]([C@H](C2=CC=C(C=C2)[N+](=O)[O-])N)N)[N+](=O)[O-].Cl.Cl

Q&A

What is the molecular weight of (1S, 2S)-1,2-Bis(4-nitrophenyl)ethane-1,2-diamine dihydrochloride?

The molecular weight is 338.75.

What are some synonyms for (1S, 2S)-1,2-Bis(4-nitrophenyl)ethane-1,2-diamine dihydrochloride?

Some synonyms include: (1S, 2S)-1,2-Bis(4-nitrophenyl)-1,2-ethanediamine dihydrochloride, (1S, 2S)-1,2-Bis(4-nitrophenyl)ethylenediamine dihydrochloride, and (1S, 2S)-1,2-Bis(4-nitrophenyl)ethane-1,2-diamine dihydrochloride.

What is the melting point of (1S, 2S)-1,2-Bis(4-nitrophenyl)ethane-1,2-diamine dihydrochloride?

The melting point is 202-207 °C.

What is the optical activity of (1S, 2S)-1,2-Bis(4-nitrophenyl)ethane-1,2-diamine dihydrochloride?

The optical activity is [α]22/D -84.0°, c = 1 in H2O.

What are the hazard codes associated with (1S, 2S)-1,2-Bis(4-nitrophenyl)ethane-1,2-diamine dihydrochloride?

The hazard code is Xn.

What is the Risk Statement for (1S, 2S)-1,2-Bis(4-nitrophenyl)ethane-1,2-diamine dihydrochloride?

The Risk Statement is 22.

What is the molecular formula of (1S, 2S)-1,2-Bis(4-nitrophenyl)ethane-1,2-diamine dihydrochloride?

The molecular formula is C14H15ClN4O4.

What is the main use of (1S, 2S)-1,2-Bis(4-nitrophenyl)ethane-1,2-diamine dihydrochloride?

It can be used to prepare a fluorous Fe-salen complex, which is used as a catalyst in the asymmetric epoxidation of C-C double bonds.

How is (1S, 2S)-1,2-Bis(4-nitrophenyl)ethane-1,2-diamine dihydrochloride used in the preparation of a fluorous Fe-salen complex?

It is used in the preparation of the fluorous Fe-salen complex as a catalyst in the asymmetric epoxidation of C-C double bonds.

In which country is (1S, 2S)-1,2-Bis(4-nitrophenyl)ethane-1,2-diamine dihydrochloride classified as WGK 3?

It is classified as WGK 3 in Germany.