(1S,2S)-1,2-Bis(4-fluorophenyl)ethane-1,2-diamine dihydrochloride

Catalog Number	ACM1052707115
CAS	1052707-11-5
Structure
Synonyms	(1S, 2S)-1,2-Bis(4-fluorophenyl)ethylenediamine dihydrochloride
IUPAC Name	(1S,2S)-1,2-bis(4-fluorophenyl)ethane-1,2-diamine;dihydrochloride
Molecular Weight	321.19
Molecular Formula	C14H16Cl2F2N2
InChI	ILMQMKZMXREKBI-AXEKQOJOSA-N
InChI Key	InChI=1S/C14H14F2N2.2ClH/c15-11-5-1-9(2-6-11)13(17)14(18)10-3-7-12(16)8-4-10;;/h1-8,13-14H,17-18H2;2*1H/t13-,14-;;/m0../s1
Melting Point	247-251 °C
Purity	97%
Appearance	White powder
Isomeric SMILES	C1=CC(=CC=C1[C@@H]([C@H](C2=CC=C(C=C2)F)N)N)F.Cl.Cl

Q&A

What is the molecular weight of (1S, 2S)-1,2-Bis(4-fluorophenyl)ethane-1,2-diamine dihydrochloride?

The molecular weight is 284.73.

What is the product name of the compound?

The product name is (1S, 2S)-1,2-Bis(4-fluorophenyl)ethylenediaMine dihydrochloride.

What are some synonyms for (1S, 2S)-1,2-Bis(4-fluorophenyl)ethane-1,2-diamine dihydrochloride?

Some synonyms are (1S, 2S)-1,2-Bis(4-fluorophenyl)ethylenediamine dihydrochloride 97%, (1S,2S)-1,2-Bis(4-fluorophenyl)-1,2-ethanediamine hydrochloride (1:2), 1,2-Ethanediamine, 1,2-bis(4-fluorophenyl)-, (1S,2S)- hydrochloride.

What is the chemical formula of (1S, 2S)-1,2-Bis(4-fluorophenyl)ethane-1,2-diamine dihydrochloride?

The chemical formula is C14H15ClF2N2.

What is the melting point of (1S, 2S)-1,2-Bis(4-fluorophenyl)ethane-1,2-diamine dihydrochloride?

The melting point is 247-251°C.

What is the optical activity of the compound?

The optical activity is [α]22/D -25.0°, c = 1 in H2O.

What hazard codes apply to (1S, 2S)-1,2-Bis(4-fluorophenyl)ethane-1,2-diamine dihydrochloride?

The hazard code is Xn.

What is the WGK Germany classification of the compound?

The WGK classification is 3.

What are the risk statements associated with (1S, 2S)-1,2-Bis(4-fluorophenyl)ethane-1,2-diamine dihydrochloride?

The risk statement is 22.

What is the chemical structure of (1S, 2S)-1,2-Bis(4-fluorophenyl)ethane-1,2-diamine dihydrochloride?

The chemical structure is (1S, 2S)-1,2-Bis(4-fluorophenyl)ethane-1,2-diamine dihydrochloride.