ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

(1S,2S)-1,2-Bis(2-chlorophenyl)ethane-1,2-diamine dihydrochloride

Catalog Number ACM1052707240
CAS 1052707-24-0
Structure {[CurrentData.Name]}
Synonyms (1S, 2S)-1,2-Bis(2-chlorophenyl)ethylenediamine dihydrochloride
IUPAC Name (1S,2S)-1,2-bis(2-chlorophenyl)ethane-1,2-diamine;dihydrochloride
Molecular Weight 354.10
Molecular Formula C14H16Cl4N2
InChI YXGVUHANCVCDJJ-AXEKQOJOSA-N
InChI Key InChI=1S/C14H14Cl2N2.2ClH/c15-11-7-3-1-5-9(11)13(17)14(18)10-6-2-4-8-12(10)16;;/h1-8,13-14H,17-18H2;2*1H/t13-,14-;;/m0../s1
Melting Point 230-235 °C
Purity 97%
Appearance White powder
Isomeric SMILES C1=CC=C(C(=C1)[C@@H]([C@H](C2=CC=CC=C2Cl)N)N)Cl.Cl.Cl
Q&A

What is the molecular weight of (1S, 2S)-1,2-Bis(2-chlorophenyl)ethane-1,2-diamine dihydrochloride?

The molecular weight is 317.64.

What is the product name of (1S, 2S)-1,2-Bis(2-chlorophenyl)ethane-1,2-diamine dihydrochloride?

The product name is (1S, 2S)-1,2-Bis(2-chlorophenyl)-1,2-ethanediamine dihydrochloride.

What are some synonyms for (1S, 2S)-1,2-Bis(2-chlorophenyl)ethane-1,2-diamine dihydrochloride?

Some synonyms include (1S, 2S)-1,2-Bis(2-chlorophenyl)-1,2-ethanediamine dihydrochloride, and (1S, 2S)-1,2-Bis(2-chlorophenyl)ethylenediamine dihydrochloride.

What is the melting point of (1S, 2S)-1,2-Bis(2-chlorophenyl)ethane-1,2-diamine dihydrochloride?

The melting point is 230-235 °C.

What is the molecular formula of (1S, 2S)-1,2-Bis(2-chlorophenyl)ethane-1,2-diamine dihydrochloride?

The molecular formula is C14H15Cl3N2.

What is the optical activity of (1S, 2S)-1,2-Bis(2-chlorophenyl)ethane-1,2-diamine dihydrochloride?

The optical activity is [α]22/D +31.0°, c = 1 in H2O.

What are the hazard codes associated with (1S, 2S)-1,2-Bis(2-chlorophenyl)ethane-1,2-diamine dihydrochloride?

The hazard codes are Xn.

What is the risk statement for (1S, 2S)-1,2-Bis(2-chlorophenyl)ethane-1,2-diamine dihydrochloride?

The risk statement is 22.

What is the WGK classification in Germany for (1S, 2S)-1,2-Bis(2-chlorophenyl)ethane-1,2-diamine dihydrochloride?

The WGK classification is 3.

What is the CAS number of (1S, 2S)-1,2-Bis(2-chlorophenyl)ethane-1,2-diamine dihydrochloride?

The CAS number is 1052707-24-0.

Please kindly note that our products and services are for research use only.