ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

(1R,2S)-rel-1,2-Bis(4-chlorophenyl)ethane-1,2-diamine

Catalog Number ACM74641308
CAS 74641-30-8
Structure {[CurrentData.Name]}
IUPAC Name 1,2-bis(4-chlorophenyl)ethane-1,2-diamine
Molecular Weight 281.18
Molecular Formula C14H14Cl2N2
InChI HHPPUZSHKRJDIW-UHFFFAOYSA-N
InChI Key InChI=1S/C14H14Cl2N2/c15-11-5-1-9(2-6-11)13(17)14(18)10-3-7-12(16)8-4-10/h1-8,13-14H,17-18H2
Boiling Point 418.6±40.0 °C(Predicted)
Purity 98%
Appearance White to yellow powder
Isomeric SMILES C1=CC(=CC=C1C(C(C2=CC=C(C=C2)Cl)N)N)Cl
Q&A

What is the chemical name of (1R,2S)-rel-1,2-Bis(4-chlorophenyl)ethane-1,2-diamine?

The chemical name of (1R,2S)-rel-1,2-Bis(4-chlorophenyl)ethane-1,2-diamine is (1R,2S)-rel-1,2-Bis(4-chlorophenyl)ethane-1,2-diamine.

What is the molecular weight of (1R,2S)-rel-1,2-Bis(4-chlorophenyl)ethane-1,2-diamine?

The molecular weight of (1R,2S)-rel-1,2-Bis(4-chlorophenyl)ethane-1,2-diamine is 281.18.

What are the product categories that (1R,2S)-rel-1,2-Bis(4-chlorophenyl)ethane-1,2-diamine belongs to?

The compound belongs to the product categories of Achiral Nitrogen and DPEN Series; organic amine.

In what form does (1R,2S)-rel-1,2-Bis(4-chlorophenyl)ethane-1,2-diamine exist?

The compound exists in powder form.

What is the predicted boiling point of (1R,2S)-rel-1,2-Bis(4-chlorophenyl)ethane-1,2-diamine?

The predicted boiling point of (1R,2S)-rel-1,2-Bis(4-chlorophenyl)ethane-1,2-diamine is 418.6±40.0 °C.

How should (1R,2S)-rel-1,2-Bis(4-chlorophenyl)ethane-1,2-diamine be stored?

The compound should be stored at 2-8°C and protected from light.

What is the sensitivity of (1R,2S)-rel-1,2-Bis(4-chlorophenyl)ethane-1,2-diamine?

The compound is air sensitive.

What is the predicted density of (1R,2S)-rel-1,2-Bis(4-chlorophenyl)ethane-1,2-diamine?

The predicted density of (1R,2S)-rel-1,2-Bis(4-chlorophenyl)ethane-1,2-diamine is 1.303±0.06 g/cm3.

What is the predicted pka of (1R,2S)-rel-1,2-Bis(4-chlorophenyl)ethane-1,2-diamine?

The predicted pka of (1R,2S)-rel-1,2-Bis(4-chlorophenyl)ethane-1,2-diamine is 9.32±0.10.

What is one of the uses of (1R,2S)-rel-1,2-Bis(4-chlorophenyl)ethane-1,2-diamine?

One of the uses of (1R,2S)-rel-1,2-Bis(4-chlorophenyl)ethane-1,2-diamine is as a reactant in the synthesis of sinomenine derivatives exhibiting potent TNF-α inhibitory activity.

Please kindly note that our products and services are for research use only.