(1R,2R)-Rel-N,N'-(cyclohexane-1,2-diyl)bis(2-(diphenylphosphino)-1-naphthamide)

Catalog Number	ACM178231624
CAS	178231-62-4
Synonyms	1-Naphthalenecarboxamide, N,N'-(1R,2R)-1,2-Cyclohexanediylbis[2-(Diphenylphosphino)-
IUPAC Name	2-diphenylphosphanyl-N-[2-[(2-diphenylphosphanylnaphthalene-1-carbonyl)amino]cyclohexyl]naphthalene-1-carboxamide
Molecular Weight	790.87
Molecular Formula	C52H44N2O2P2
InChI	VXFKMKXTPXVEMU-UHFFFAOYSA-N
InChI Key	InChI=1S/C52H44N2O2P2/c55-51(49-43-29-15-13-19-37(43)33-35-47(49)57(39-21-5-1-6-22-39)40-23-7-2-8-24-40)53-45-31-17-18-32-46(45)54-52(56)50-44-30-16-14-20-38(44)34-36-48(50)58(41-25-9-3-10-26-41)42-27-11-4-12-28-42/h1-16,19-30,33-36,45-46H,17-18,31-32H2,(H,53,55)(H,54,56)
Purity	97%
Isomeric SMILES	C1CCC(C(C1)NC(=O)C2=C(C=CC3=CC=CC=C32)P(C4=CC=CC=C4)C5=CC=CC=C5)NC(=O)C6=C(C=CC7=CC=CC=C76)P(C8=CC=CC=C8)C9=CC=CC=C9

Q&A

What is the CAS number for the compound described?

The CAS number for the compound described is 178231-62-4.

What is the molecular weight of the compound?

The molecular weight of the compound is 790.87.

What is the full product name of the compound?

The full product name of the compound is 2-diphenylphosphanyl-N-[(1S,2S)-2-[(2-diphenylphosphanylnaphthalene-1-carbonyl)amino]cyclohexyl]naphthalene-1-carboxamide.

What are some synonyms for the compound?

Some synonyms for the compound are 2-diphenylphosphanyl-N-[(1S,2S)-2-[(2-diphenylphosphanylnaphthalene-1-carbonyl)amino]cyclohexyl]naphthalene-1-carboxamide, and more.

What is the molecular formula of the compound?

The molecular formula of the compound is C52H44N2O2P2.

What is the structure of the compound?

The compound has a complex structure with multiple phosphorus and nitrogen atoms arranged in a cyclohexane backbone.

Is the compound chiral?

Yes, the compound is chiral as it contains chiral centers with the prefixes (1R,2R).

What functional groups are present in the compound?

The compound contains phosphanyl, carbonyl, amide, and naphthalene functional groups.

How many phosphorus atoms are in the compound?

There are two phosphorus atoms in the compound.

What is the systematic name of the compound?

The systematic name of the compound is (1R,2R)-Rel-N,N'-(cyclohexane-1,2-diyl)bis(2-(diphenylphosphino)-1-naphthamide).