ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

(1R,2R)-N1,N2-Dibenzylcyclohexane-1,2-diamine dihydrochloride

Catalog Number ACM212611886
CAS 212611-88-6
IUPAC Name (1R,2R)-1-N,2-N-dibenzylcyclohexane-1,2-diamine;dihydrochloride
Molecular Weight 367.36
Molecular Formula C20H28Cl2N2
InChI RIJQPRPIYQEHFC-WUMQWIPTSA-N
InChI Key InChI=1S/C20H26N2.2ClH/c1-3-9-17(10-4-1)15-21-19-13-7-8-14-20(19)22-16-18-11-5-2-6-12-18;;/h1-6,9-12,19-22H,7-8,13-16H2;2*1H/t19-,20-;;/m1../s1
Purity 98%
Appearance White to light yellow powder
Isomeric SMILES C1CC[C@H]([C@@H](C1)NCC2=CC=CC=C2)NCC3=CC=CC=C3.Cl.Cl
Q&A

What is the molecular weight of (1R,2R)-N',N'-bis(phenylMethyl)-,1,2-CyclohexanediaMine Hydrochloride?

The molecular weight is 367.35572.

What is the form of (1R,2R)-N1,N2-Dibenzylcyclohexane-1,2-diamine dihydrochloride?

It is in powder form.

What is the color of (1R,2R)-N1,N2-Dibenzylcyclohexane-1,2-diamine dihydrochloride?

The color is white to light-yellow.

What is a specific reaction that (1R,2R)-N1,N2-Dibenzylcyclohexane-1,2-diamine dihydrochloride can be used in?

It can be used as a ligand for Ni-catalyzed enantioselective Michael additions of 1,3-dicarbonyl compounds to nitroalkenes.

What is another reaction that (1R,2R)-N1,N2-Dibenzylcyclohexane-1,2-diamine dihydrochloride is a ligand for?

It is a ligand for Ni-catalyzed enantioselective conjugate addition of α-Ketoesters to nitroalkenes.

What is the full chemical name of the compound?

The full chemical name is (1R,2R)-N,N'-Bis(phenylmethyl)-1,2-cyclohexanediamine dihydrochloride.

What is the chemical formula of (1R,2R)-N1,N2-Dibenzylcyclohexane-1,2-diamine dihydrochloride?

The chemical formula is C20H28Cl2N2.

What is the purity of the compound when in the form of (1R,2R)-N,N'-Bis(phenylmethyl)-1,2-cyclohexanediamine Dihydrochloride?

It is a minimum of 98% pure.

What are some synonyms for (1R,2R)-N1,N2-Dibenzylcyclohexane-1,2-diamine dihydrochloride?

Some synonyms include (1R,2R)-N',N'-bis(phenylMethyl)-,1,2-CyclohexanediaMine Hydrochloride (1:2) and (1R,2R)-N,N'-Bis(phenylmethyl)-1,2-cyclohexanediamine Dihydrochloride.

Please kindly note that our products and services are for research use only.