(1R,2R)-N,N'-(Cyclohexane-1,2-diyl)bis(2-(diphenylphosphino)benzamide)

Catalog Number	ACM138517610-1
CAS	138517-61-0
Structure
Synonyms	(R,R)-DACH-Phenyl Trost Ligand
IUPAC Name	2-diphenylphosphanyl-N-[(1R,2R)-2-[(2-diphenylphosphanylbenzoyl)amino]cyclohexyl]benzamide
Molecular Weight	690.75
Molecular Formula	C44H40N2O2P2
InChI	AXMSEDAJMGFTLR-XRSDMRJBSA-N
InChI Key	InChI=1S/C44H40N2O2P2/c47-43(37-27-13-17-31-41(37)49(33-19-5-1-6-20-33)34-21-7-2-8-22-34)45-39-29-15-16-30-40(39)46-44(48)38-28-14-18-32-42(38)50(35-23-9-3-10-24-35)36-25-11-4-12-26-36/h1-14,17-28,31-32,39-40H,15-16,29-30H2,(H,45,47)(H,46,48)/t39-,40-/m1/s1
Boiling Point	817.0±65.0 °C(Predicted)
Melting Point	134-136 °C
Purity	98%
Appearance	White to off-white powder
Isomeric SMILES	C1CC[C@H]([C@@H](C1)NC(=O)C2=CC=CC=C2P(C3=CC=CC=C3)C4=CC=CC=C4)NC(=O)C5=CC=CC=C5P(C6=CC=CC=C6)C7=CC=CC=C7

Q&A

What is the Chemical Abstracts Service (CAS) number for the compound?

CAS number for the compound is 138517-61-0.

What is the molecular weight of the compound?

The molecular weight is 690.75.

What are the product categories that this compound belongs to?

The product categories are Chiral Nitrogen and DACH&Trost Series.

What is the product name of the compound?

The product name is (1R,2R)-(+)-1,2-DIAMINOCYCLOHEXANE-N,N'-BIS(2'-DIPHENYLPHOSPHINOBENZOYL).

What is the synonym for the compound?

One of the synonyms is Benzamide, N,N'-(1R,2R)-1,2-cyclohexanediylbis[2-(diphenylphosphino)-.

What is the chemical formula of the compound?

The chemical formula is C44H40N2O2P2.

What is the melting point of the compound?

The melting point is 134-136°C.

What is the boiling point of the compound?

The predicted boiling point is 817.0±65.0 °C.

What is the form and color of the compound?

The compound is in powder form and is white to off-white in color.

What is the main reaction that the Trost ligands are effective in?

The palladium complexes of the Trost ligands are effective in a variety of allylic substitution reactions involving carbon, nitrogen, oxygen, sulfur, and fluorides nucleophiles.