(1R,2R)-N-Boc-1,2-cyclohexanediamine

Catalog Number	ACM146504076-1
CAS	146504-07-6
Structure
Synonyms	(1R)-trans-N-Boc-1,2-diaminocyclohexane
IUPAC Name	tert-butyl N-[(1R,2R)-2-aminocyclohexyl]carbamate
Molecular Weight	214.30
Molecular Formula	C11H22N2O2
InChI	AKVIZYGPJIWKOS-RKDXNWHRSA-N
InChI Key	InChI=1S/C11H22N2O2/c1-11(2,3)15-10(14)13-9-7-5-4-6-8(9)12/h8-9H,4-7,12H2,1-3H3,(H,13,14)/t8-,9-/m1/s1
Boiling Point	322.1 °C at 760 mmHg
Purity	98%
Appearance	White crystalline
Isomeric SMILES	CC(C)(C)OC(=O)N[C@@H]1CCCC[C@H]1N

Q&A

What is the molecular weight of (1R,2R)-trans-N-Boc-1,2-Cyclohexanediamine?

The molecular weight of (1R,2R)-trans-N-Boc-1,2-Cyclohexanediamine is 214.3.

What is the melting point of (1R,2R)-trans-N-Boc-1,2-Cyclohexanediamine?

The melting point of (1R,2R)-trans-N-Boc-1,2-Cyclohexanediamine is 114-115℃.

What is the density of (1R,2R)-trans-N-Boc-1,2-Cyclohexanediamine?

The density of (1R,2R)-trans-N-Boc-1,2-Cyclohexanediamine is 1.02±0.1 g/cm3 (Predicted).

What is the pka value of (1R,2R)-trans-N-Boc-1,2-Cyclohexanediamine?

The pka value of (1R,2R)-trans-N-Boc-1,2-Cyclohexanediamine is 12.26±0.40 (Predicted).

What is the color of (1R,2R)-trans-N-Boc-1,2-Cyclohexanediamine?

The color of (1R,2R)-trans-N-Boc-1,2-Cyclohexanediamine is White to Almost white.

What is the boiling point of (1R,2R)-trans-N-Boc-1,2-Cyclohexanediamine?

The boiling point of (1R,2R)-trans-N-Boc-1,2-Cyclohexanediamine is 322.1±31.0 °C (Predicted).

What is the optical activity of (1R,2R)-trans-N-Boc-1,2-Cyclohexanediamine?

The optical activity of (1R,2R)-trans-N-Boc-1,2-Cyclohexanediamine is [α]/D -26±2°, c = 1 in chloroform.

What are the hazard codes associated with (1R,2R)-trans-N-Boc-1,2-Cyclohexanediamine?

The hazard codes associated with (1R,2R)-trans-N-Boc-1,2-Cyclohexanediamine are C.

What are the safety statements for handling (1R,2R)-trans-N-Boc-1,2-Cyclohexanediamine?

The safety statements for handling (1R,2R)-trans-N-Boc-1,2-Cyclohexanediamine are 26-36/37/39-45.

What are the uses of (1R,2R)-trans-N-Boc-1,2-Cyclohexanediamine?

(1R,2R)-trans-N-Boc-1,2-Cyclohexanediamine can be used as an organocatalyst in the intramolecular desymmetrization of cyclohexanones and as a starting material in the synthesis of a chiral nickel catalyst for the Michael addition reaction.