(1R,2R)-2-(Piperidin-1-yl)cyclohexanamine

Catalog Number	ACM885677918
CAS	885677-91-8
Structure
Synonyms	(1R,2R)-trans-2-(1-Piperidinyl) cyclohexylamine
IUPAC Name	(1R,2R)-2-piperidin-1-ylcyclohexan-1-amine
Molecular Weight	182.31
Molecular Formula	C11H22N2
InChI	QHFKXCGYRHKLNG-GHMZBOCLSA-N
InChI Key	InChI=1S/C11H22N2/c12-10-6-2-3-7-11(10)13-8-4-1-5-9-13/h10-11H,1-9,12H2/t10-,11-/m1/s1
Purity	95%
Isomeric SMILES	C1CCN(CC1)[C@@H]2CCCC[C@H]2N

Q&A

What is the CAS number for (1R,2R)-2-(Piperidin-1-yl)cyclohexanamine?

The CAS number is 885677-91-8.

What is the molecular weight of (1R,2R)-2-(Piperidin-1-yl)cyclohexanamine?

The molecular weight is 182.31.

What are some synonyms for (1R,2R)-2-(Piperidin-1-yl)cyclohexanamine?

Some synonyms include (1R,2R)-trans-2-(1-Piperidinyl) cyclohexylamine and Cyclohexanamine, 2-(1-piperidinyl)-, (1R,2R)-.

What is the predicted boiling point of (1R,2R)-2-(Piperidin-1-yl)cyclohexanamine?

The predicted boiling point is 247.1±8.0 °C.

How should (1R,2R)-2-(Piperidin-1-yl)cyclohexanamine be stored?

It should be stored in a dark place, in an inert atmosphere, at room temperature.

What is the optical activity of (1R,2R)-2-(Piperidin-1-yl)cyclohexanamine in chloroform?

The optical activity is [α]/D -53.0±1.5°, c = 1 in chloroform.

What is the predicted density of (1R,2R)-2-(Piperidin-1-yl)cyclohexanamine?

The predicted density is 0.984±0.06 g/cm3.

What is the predicted pKa value of (1R,2R)-2-(Piperidin-1-yl)cyclohexanamine?

The predicted pKa value is 11.02±0.70.

What are the Hazard Codes associated with (1R,2R)-2-(Piperidin-1-yl)cyclohexanamine?

The Hazard Code is C.

What are the Risk Statements associated with (1R,2R)-2-(Piperidin-1-yl)cyclohexanamine?

The Risk Statement is 34.