ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

(1R,2R)-1,2-Dimesitylethane-1,2-diamine

Catalog Number ACM425615425-1
CAS 425615-42-5
Structure {[CurrentData.Name]}
Synonyms (1R,2R)-1,2-Bis(2,4,6-trimethylphenyl)ethylenediamine
IUPAC Name (1R,2R)-1,2-bis(2,4,6-trimethylphenyl)ethane-1,2-diamine
Molecular Weight 296.45
Molecular Formula C20H28N2
Canonical SMILES CC1=CC(=C(C(=C1)C)C(C(C2=C(C=C(C=C2C)C)C)N)N)C
InChI ILMRHFMYIXTNMC-WOJBJXKFSA-N
InChI Key InChI=1S/C20H28N2/c1-11-7-13(3)17(14(4)8-11)19(21)20(22)18-15(5)9-12(2)10-16(18)6/h7-10,19-20H,21-22H2,1-6H3/t19-,20-/m1/s1
Melting Point 84-88 °C
Purity 98%
Exact Mass 296.225248902
Heavy Atom Count 22
Hydrogen Bond Acceptor Count 2
Hydrogen Bond Donor Count 2
Isomeric SMILES CC1=CC(=C(C(=C1)C)[C@H]([C@@H](C2=C(C=C(C=C2C)C)C)N)N)C
Monoisotopic Mass 296.225248902
Rotatable Bond Count 3
Topological Polar Surface Area 52 Ų
Q&A

What is the molecular weight of (1R,2R)-1,2-Dimesitylethane-1,2-diamine?

The molecular weight is 296.45.

What are the product categories that (1R,2R)-1,2-Dimesitylethane-1,2-diamine belongs to?

Amines (Chiral), Chiral Building Blocks, and Synthetic Organic Chemistry.

What is the melting point of (1R,2R)-1,2-Dimesitylethane-1,2-diamine?

The melting point is 84.0 to 88.0 °C.

What is the density of (1R,2R)-1,2-Dimesitylethane-1,2-diamine?

The density is 1.024±0.06 g/cm3 (Predicted).

What is the boiling point of (1R,2R)-1,2-Dimesitylethane-1,2-diamine?

The boiling point is 451.7±40.0 °C (Predicted).

What is the pka value of (1R,2R)-1,2-Dimesitylethane-1,2-diamine?

The pka value is 10.43±0.10 (Predicted).

What are the synonyms of (1R,2R)-1,2-Dimesitylethane-1,2-diamine?

Some synonyms include (1R,2R)-1,2-DIMESITYLETHYLENEDIAMINE and (1R,2R)-1,2-DIAMINO-1,2-DIMESITYLETHANE.

What are the risk statements associated with (1R,2R)-1,2-Dimesitylethane-1,2-diamine?

The risk statements are 36/37/38.

What is the HS Code of (1R,2R)-1,2-Dimesitylethane-1,2-diamine?

The HS Code is 2921.51.5000.

What are the safety statements for handling (1R,2R)-1,2-Dimesitylethane-1,2-diamine?

The safety statements are 26-36.

Please kindly note that our products and services are for research use only.