ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

12-Hydroxy-1,10-bis(3,3'',5,5''-tetrakis(trifluoromethyl)-[1,1':3',1''-terphenyl]-5'-yl)-4,5,6,7-tetrahydrodiindeno[7,1-de:1',7'-fg][1,3,2]dioxaphosphocine 12-oxide

Catalog Number ACMA00040990
Molecular Weight 1314.83
Molecular Formula C61H31F24O4P
Purity 98%
Q&A

What is the exact mass of 12-Hydroxy-1,10-bis(3,3'',5,5''-tetrakis(trifluoromethyl)-[1,1':3',1''-terphenyl]-5'-yl)-4,5,6,7-tetrahydrodiindeno[7,1-de:1',7'-fg][1,3,2]dioxaphosphocine 12-oxide?

The exact mass is 1314.1576724.

What is the molecular formula of the compound?

The molecular formula is C61H31F24O4P.

How many hydrogen bond acceptor counts does the compound have?

The compound has 28 hydrogen bond acceptor counts.

What is the canonical SMILES of the compound?

C1CC23CCC4=C2C(=C(C=C4)C5=CC(=CC(=C5)C6=CC(=CC(=C6)C(F)(F)F)C(F)(F)F)C7=CC(=CC(=C7)C(F)(F)F)C(F)(F)F)OP(=O)(OC8=C(C=CC1=C38)C9=CC(=CC(=C9)C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)O

What is the name of the compound based on the IUPAC name?

The compound is named 1,10-bis[3,5-bis[3,5-bis(trifluoromethyl)phenyl]phenyl]-12-hydroxy-4,5,6,7-tetrahydroiindeno[7,1-de:1',7'-fg][1,3,2]dioxaphosphocine 12-oxide.

How many defined atom stereocenter counts does the compound have?

The compound has 0 defined atom stereocenter counts.

What is the computed property for the XLogP3 of the compound?

The XLogP3 of the compound is 20.4.

What are the depositor-supplied synonyms for the compound?

The depositor-supplied synonyms include "(11AR)-12-hydroxy-1,10-bis(3,3'',5,5''-tetrakis(trifluoromethyl)-[1,1':3',1''-terphenyl]-5'-yl)-4,5,6,7-tetrahydrodiindeno[7,1-de:1',7'-fg][1,3,2]dioxaphosphocine 12-oxide" and "(11AS)-12-hydroxy-1,10-bis(3,3'',5,5''-tetrakis(trifluoromethyl)-[1,1':3',1''-terphenyl]-5'-yl)-4,5,6,7-tetrahydrodiindeno[7,1-de:1',7'-fg][1,3,2]dioxaphosphocine 12-oxide".

What is the molecular weight of the compound?

The molecular weight is 1314.8 g/mol.

What is the InChIKey for the compound?

The InChIKey is PYUJPINRSALQLD-UHFFFAOYSA-N.

Please kindly note that our products and services are for research use only.