What is the exact mass of 12-Hydroxy-1,10-bis(3,3'',5,5''-tetrakis(trifluoromethyl)-[1,1':3',1''-terphenyl]-5'-yl)-4,5,6,7-tetrahydrodiindeno[7,1-de:1',7'-fg][1,3,2]dioxaphosphocine 12-oxide?
The exact mass is 1314.1576724.
What is the molecular formula of the compound?
The molecular formula is C61H31F24O4P.
How many hydrogen bond acceptor counts does the compound have?
The compound has 28 hydrogen bond acceptor counts.
What is the canonical SMILES of the compound?
C1CC23CCC4=C2C(=C(C=C4)C5=CC(=CC(=C5)C6=CC(=CC(=C6)C(F)(F)F)C(F)(F)F)C7=CC(=CC(=C7)C(F)(F)F)C(F)(F)F)OP(=O)(OC8=C(C=CC1=C38)C9=CC(=CC(=C9)C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)O
What is the name of the compound based on the IUPAC name?
The compound is named 1,10-bis[3,5-bis[3,5-bis(trifluoromethyl)phenyl]phenyl]-12-hydroxy-4,5,6,7-tetrahydroiindeno[7,1-de:1',7'-fg][1,3,2]dioxaphosphocine 12-oxide.
How many defined atom stereocenter counts does the compound have?
The compound has 0 defined atom stereocenter counts.
What is the computed property for the XLogP3 of the compound?
The XLogP3 of the compound is 20.4.
What are the depositor-supplied synonyms for the compound?
The depositor-supplied synonyms include "(11AR)-12-hydroxy-1,10-bis(3,3'',5,5''-tetrakis(trifluoromethyl)-[1,1':3',1''-terphenyl]-5'-yl)-4,5,6,7-tetrahydrodiindeno[7,1-de:1',7'-fg][1,3,2]dioxaphosphocine 12-oxide" and "(11AS)-12-hydroxy-1,10-bis(3,3'',5,5''-tetrakis(trifluoromethyl)-[1,1':3',1''-terphenyl]-5'-yl)-4,5,6,7-tetrahydrodiindeno[7,1-de:1',7'-fg][1,3,2]dioxaphosphocine 12-oxide".
What is the molecular weight of the compound?
The molecular weight is 1314.8 g/mol.
What is the InChIKey for the compound?
The InChIKey is PYUJPINRSALQLD-UHFFFAOYSA-N.