What is the European Community (EC) Number of N,N,2,6-Tetramethyldinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepin-4-amine?
The European Community (EC) Number is 813-830-0.
What is the Canonical SMILES of N,N,2,6-Tetramethyldinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepin-4-amine?
The Canonical SMILES is CC1=CC2=CC=CC=C2C3=C1OP(OC4=C3C5=CC=CC=C5C=C4C)N(C)C
What is the CAS number of N,N,2,6-Tetramethyldinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepin-4-amine?
The CAS number is 185449-86-9.
How many Heavy Atom Counts are in the molecule?
The molecule has 28 Heavy Atom Counts.
What is the XLogP3 value of N,N,2,6-Tetramethyldinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepin-4-amine?
The XLogP3 value is 6.8.
What is the Molecular Formula of N,N,2,6-Tetramethyldinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepin-4-amine?
The Molecular Formula is C24H22NO2P.
What is the IUPAC Name of the compound?
The IUPAC Name is N,N,10,16-tetramethyl-12,14-dioxa-13-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-amine.
What is the Monoisotopic Mass of N,N,2,6-Tetramethyldinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepin-4-amine?
The Monoisotopic Mass is 387.13881594.
What is the InChI Key of the compound?
The InChI Key is MXASPZVRFOFONU-UHFFFAOYSA-N.