1-Benzyl-1,4-azaphosphinane 4-oxide

Catalog Number	ACM1415141820
CAS	1415141-82-0
Synonyms	1,4-Azaphosphorine, hexahydro-1-(phenylmethyl)-, 4-oxide
IUPAC Name	1-benzyl-1,4-azaphosphinan-4-ium 4-oxide
Molecular Weight	209.22
Molecular Formula	C11H16NOP
InChI	FKVYQFJORQDMPH-UHFFFAOYSA-N
InChI Key	InChI=1S/C11H15NOP/c13-14-8-6-12(7-9-14)10-11-4-2-1-3-5-11/h1-5H,6-10H2/q+1
Purity	98%
Isomeric SMILES	C1C[P+](=O)CCN1CC2=CC=CC=C2

Q&A

What is the Canonical SMILES for 1-Benzyl-1,4-azaphosphinane 4-oxide?

The Canonical SMILES is C1C[P+](=O)CCN1CC2=CC=CC=C2.

How many Covalently-Bonded Unit Counts of 1-Benzyl-1,4-azaphosphinane 4-oxide are there?

There is 1 Covalently-Bonded Unit Count for 1-Benzyl-1,4-azaphosphinane 4-oxide.

What is the Formal Charge of 1-Benzyl-1,4-azaphosphinane 4-oxide?

The Formal Charge is 1.

How many Hydrogen Bond Acceptor Counts are there in 1-Benzyl-1,4-azaphosphinane 4-oxide?

There are 2 Hydrogen Bond Acceptor Counts.

What is the XLogP3 value of 1-Benzyl-1,4-azaphosphinane 4-oxide?

The XLogP3 value is 0.3.

What is the Molecular Formula of 1-Benzyl-1,4-azaphosphinane 4-oxide?

The Molecular Formula is C11H15NOP+.

What is the IUPAC Name for 1-Benzyl-1,4-azaphosphinane 4-oxide?

The IUPAC Name is 1-benzyl-1,4-azaphosphinan-4-ium 4-oxide.

What is the InChIKey for 1-Benzyl-1,4-azaphosphinane 4-oxide?

The InChIKey is FKVYQFJORQDMPH-UHFFFAOYSA-N.

What is the Molecular Weight of 1-Benzyl-1,4-azaphosphinane 4-oxide?

The Molecular Weight is 208.22g/mol.

How many Defined Atom Stereocenter Counts are there in 1-Benzyl-1,4-azaphosphinane 4-oxide?

There is 0 Defined Atom Stereocenter Count.