1-Benzyl-1,4,7,10-tetraazacyclododecane

Catalog Number	ACM112193836-1
CAS	112193-83-6
Structure
Synonyms	N-Benzyl-1,4,7,10-tetraazacyclododecane; Mono-N-Benzyl-Cyclen
IUPAC Name	1-benzyl-1,4,7,10-tetrazacyclododecane
Molecular Weight	262.39
Molecular Formula	C15H26N4
InChI	FURLCQRFFWBENR-UHFFFAOYSA-N
InChI Key	InChI=1S/C15H26N4/c1-2-4-15(5-3-1)14-19-12-10-17-8-6-16-7-9-18-11-13-19/h1-5,16-18H,6-14H2
Boiling Point	412.2±35.0 °C(Predicted)
Melting Point	84-86 °C
Purity	98%
Appearance	White to yellow powder
Isomeric SMILES	C1CNCCN(CCNCCN1)CC2=CC=CC=C2

Q&A

What is the molecular weight of 1-Benzyl-1,4,7,10-tetraazacyclododecane?

The molecular weight of 1-Benzyl-1,4,7,10-tetraazacyclododecane is 262.39.

What are the product categories to which 1-Benzyl-1,4,7,10-tetraazacyclododecane belongs?

1-Benzyl-1,4,7,10-tetraazacyclododecane belongs to the product category of organic amine.

What are some synonyms for 1-Benzyl-1,4,7,10-tetraazacyclododecane?

Some synonyms for 1-Benzyl-1,4,7,10-tetraazacyclododecane include N-Benzyl-1,4,7,10-tetraazacyclododecane, Mono-N-Benzyl-Cyclen, and Gadobutrol Impurity 126.

What is the molecular formula of 1-Benzyl-1,4,7,10-tetraazacyclododecane?

The molecular formula of 1-Benzyl-1,4,7,10-tetraazacyclododecane is C15H26N4.

What is the melting point range of 1-Benzyl-1,4,7,10-tetraazacyclododecane?

The melting point range of 1-Benzyl-1,4,7,10-tetraazacyclododecane is 84-86°C.

What is the predicted density of 1-Benzyl-1,4,7,10-tetraazacyclododecane?

The predicted density of 1-Benzyl-1,4,7,10-tetraazacyclododecane is 0.970±0.06 g/cm3.

What is the color of 1-Benzyl-1,4,7,10-tetraazacyclododecane?

The color of 1-Benzyl-1,4,7,10-tetraazacyclododecane is white to yellow.

How sensitive is 1-Benzyl-1,4,7,10-tetraazacyclododecane?

1-Benzyl-1,4,7,10-tetraazacyclododecane is hygroscopic, meaning it is sensitive to moisture.

What is the predicted boiling point of 1-Benzyl-1,4,7,10-tetraazacyclododecane?

The predicted boiling point of 1-Benzyl-1,4,7,10-tetraazacyclododecane is 412.2±35.0 °C.

What are some of the uses of 1-Benzyl-1,4,7,10-tetraazacyclododecane?

1-Benzyl-1,4,7,10-tetraazacyclododecane is used as ligands for catalysts.