ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

1,7-Dibenzyl-1,4,7,10-tetraazacyclododecane

Catalog Number ACM156970795-1
CAS 156970-79-5
Structure {[CurrentData.Name]}
Synonyms Trans-N-Dibenzyl-Cyclen
IUPAC Name 1,7-dibenzyl-1,4,7,10-tetrazacyclododecane
Molecular Weight 352.52
Molecular Formula C22H32N4
InChI CLXIHHGLHPVIIQ-UHFFFAOYSA-N
InChI Key InChI=1S/C22H32N4/c1-3-7-21(8-4-1)19-25-15-11-23-13-17-26(18-14-24-12-16-25)20-22-9-5-2-6-10-22/h1-10,23-24H,11-20H2
Purity 98%
Isomeric SMILES C1CN(CCNCCN(CCN1)CC2=CC=CC=C2)CC3=CC=CC=C3
Q&A

What is the molecular weight of 1,7-Dibenzyl-1,4,7,10-tetraazacyclododecane?

The molecular weight is 352.52.

What are some synonyms for 1,7-Dibenzyl-1,4,7,10-tetraazacyclododecane?

Some synonyms include Trans-N-Dibenzyl-Cyclen and 1,7-Bis(phenylmethyl)-1,4,7,10-tetraazacyclododecane.

What is the chemical formula for 1,7-Dibenzyl-1,4,7,10-tetraazacyclododecane?

The chemical formula is C22H32N4.

What is the predicted boiling point of 1,7-Dibenzyl-1,4,7,10-tetraazacyclododecane?

The predicted boiling point is 494.6±40.0 °C.

How should 1,7-Dibenzyl-1,4,7,10-tetraazacyclododecane be stored?

It should be stored under inert gas (nitrogen or Argon) at 2-8°C.

What is the sensitivity of 1,7-Dibenzyl-1,4,7,10-tetraazacyclododecane?

It is hygroscopic.

What is the predicted density of 1,7-Dibenzyl-1,4,7,10-tetraazacyclododecane?

The predicted density is 1.025±0.06 g/cm3.

What is the predicted pka value for 1,7-Dibenzyl-1,4,7,10-tetraazacyclododecane?

The predicted pka value is 10.08±0.20.

What hazard code is associated with 1,7-Dibenzyl-1,4,7,10-tetraazacyclododecane?

The hazard code is Xn.

What is the risk statement associated with 1,7-Dibenzyl-1,4,7,10-tetraazacyclododecane?

The risk statement is 22.

Please kindly note that our products and services are for research use only.