How many Computed Properties Rotatable Bond Count does 1,5-Bis(di-t-butylphosphino)pentane have?
1,5-Bis(di-t-butylphosphino)pentane has 10 Computed Properties Rotatable Bond Count.
What is the Canonical SMILES notation for 1,5-Bis(di-t-butylphosphino)pentane?
The Canonical SMILES notation for 1,5-Bis(di-t-butylphosphino)pentane is CC(C)(C)P(CCCCCP(C(C)(C)C)C(C)(C)C)C(C)(C)C
How many Computed Properties Defined Atom Stereocenter Count does 1,5-Bis(di-t-butylphosphino)pentane have?
1,5-Bis(di-t-butylphosphino)pentane has 0 Computed Properties Defined Atom Stereocenter Count.
What is the Computed Properties XLogP3 value for 1,5-Bis(di-t-butylphosphino)pentane?
The Computed Properties XLogP3 value for 1,5-Bis(di-t-butylphosphino)pentane is 4.7.
What is the Depositor-Supplied Synonym for 1,5-Bis(di-t-butylphosphino)pentane with CAS number 65420-68-0?
One of the Depositor-Supplied Synonyms is di(tert-butyl)(5-[di(tert-butyl)phosphino]pentyl)phosphine.
What is the Molecular Formula of 1,5-Bis(di-t-butylphosphino)pentane?
The Molecular Formula of 1,5-Bis(di-t-butylphosphino)pentane is C21H46P2.
What is the European Community (EC) Number for 1,5-Bis(di-t-butylphosphino)pentane?
The European Community (EC) Number for 1,5-Bis(di-t-butylphosphino)pentane is 811-887-6.
What is the InChIKey for 1,5-Bis(di-t-butylphosphino)pentane?
The InChIKey for 1,5-Bis(di-t-butylphosphino)pentane is LZOGYLUPNPTZLL-UHFFFAOYSA-N.
What is the Molecular Weight of 1,5-Bis(di-t-butylphosphino)pentane?
The Molecular Weight of 1,5-Bis(di-t-butylphosphino)pentane is 360.5g/mol.