1,4-Bis(5-phenyl-4,5-dihydrooxazol-2-yl)benzene

Catalog Number	ACM15502520
CAS	15502-52-0
Synonyms	5-Phenyl-2-[4-(5-phenyl-4,5-dihydro-1,3-oxazol-2-yl)phenyl]-4,5-dihydro-1,3-oxazole
IUPAC Name	5-phenyl-2-[4-(5-phenyl-4,5-dihydro-1,3-oxazol-2-yl)phenyl]-4,5-dihydro-1,3-oxazole
Molecular Weight	368.43
Molecular Formula	C24H20N2O2
InChI	SXFWXWSOMDSZFE-UHFFFAOYSA-N
InChI Key	InChI=1S/C24H20N2O2/c1-3-7-17(8-4-1)21-15-25-23(27-21)19-11-13-20(14-12-19)24-26-16-22(28-24)18-9-5-2-6-10-18/h1-14,21-22H,15-16H2
Purity	98%
Isomeric SMILES	C1C(OC(=N1)C2=CC=C(C=C2)C3=NCC(O3)C4=CC=CC=C4)C5=CC=CC=C5

Q&A

What is the CAS number for the compound 1,4-Bis(5-phenyl-4,5-dihydrooxazol-2-yl)benzene?

The CAS number for the compound is 15502-52-0.

What is the molecular weight of 1,4-Bis(5-phenyl-4,5-dihydrooxazol-2-yl)benzene?

The molecular weight is 368.43.

What is the product name of the compound?

The product name is Oxazole, 2,2'-(1,4-phenylene)bis[4,5-dihydro-5-phenyl-.

What are the synonyms for 1,4-Bis(5-phenyl-4,5-dihydrooxazol-2-yl)benzene?

The synonyms are Oxazole, 2,2'-(1,4-phenylene)bis[4,5-dihydro-5-phenyl- and 1,4-Bis(5-phenyl-4,5-dihydrooxazol-2-yl)benzene.

What is the molecular formula of the compound?

The molecular formula is C24H20N2O2.

What is the predicted boiling point of 1,4-Bis(5-phenyl-4,5-dihydrooxazol-2-yl)benzene?

The predicted boiling point is 561.9±50.0 °C.

What is the predicted pka value of the compound?

The predicted pka value is 4.03±0.70.

What is the predicted density of 1,4-Bis(5-phenyl-4,5-dihydrooxazol-2-yl)benzene?

The predicted density is 1.23±0.1 g/cm3.

How many phenyl rings are present in the structure of 1,4-Bis(5-phenyl-4,5-dihydrooxazol-2-yl)benzene?

There are two phenyl rings present in the structure.

What functional groups are present in the compound?

The compound contains oxazole and benzene functional groups.