1,4-Bis(4-phenyloxazol-2-yl)benzene

Catalog Number	ACM24171399
CAS	24171-39-9
Synonyms	1,4-Di(2,5-Phenyloxazolyl)Benzene; 4-Phenyl-2-[4-(4-phenyl-1,3-oxazol-2-yl)phenyl]-1,3-oxazole
IUPAC Name	4-phenyl-2-[4-(4-phenyl-1,3-oxazol-2-yl)phenyl]-1,3-oxazole
Molecular Weight	364.40
Molecular Formula	C24H16N2O2
InChI	PXVAVQOLTXAZRC-UHFFFAOYSA-N
InChI Key	InChI=1S/C24H16N2O2/c1-3-7-17(8-4-1)21-15-27-23(25-21)19-11-13-20(14-12-19)24-26-22(16-28-24)18-9-5-2-6-10-18/h1-16H
Purity	98%
Isomeric SMILES	C1=CC=C(C=C1)C2=COC(=N2)C3=CC=C(C=C3)C4=NC(=CO4)C5=CC=CC=C5

Q&A

What is the CAS number of 1,4-Bis(4-phenyloxazol-2-yl)benzene?

The CAS number of 1,4-Bis(4-phenyloxazol-2-yl)benzene is 24171-39-9.

What is the molecular weight of 1,4-Bis(4-phenyloxazol-2-yl)benzene?

The molecular weight of 1,4-Bis(4-phenyloxazol-2-yl)benzene is 364.4.

What is the chemical formula of 1,4-Bis(4-phenyloxazol-2-yl)benzene?

The chemical formula of 1,4-Bis(4-phenyloxazol-2-yl)benzene is C24H16N2O2.

What is the melting point of 1,4-Bis(4-phenyloxazol-2-yl)benzene?

The melting point of 1,4-Bis(4-phenyloxazol-2-yl)benzene is 250 °C.

What is the density of 1,4-Bis(4-phenyloxazol-2-yl)benzene (predicted)?

The density of 1,4-Bis(4-phenyloxazol-2-yl)benzene is predicted to be 1.204±0.06 g/cm3.

What is the boiling point of 1,4-Bis(4-phenyloxazol-2-yl)benzene (predicted)?

The boiling point of 1,4-Bis(4-phenyloxazol-2-yl)benzene is predicted to be 585.1±60.0 °C.

What is the pka value of 1,4-Bis(4-phenyloxazol-2-yl)benzene (predicted)?

The pka value of 1,4-Bis(4-phenyloxazol-2-yl)benzene is predicted to be -0.33±0.10.

What is another name for 1,4-Bis(4-phenyloxazol-2-yl)benzene?

Another name for 1,4-Bis(4-phenyloxazol-2-yl)benzene is Oxazole, 2,2'-p-phenylenebis[4-phenyl- (8CI).

How many phenyl groups are attached to the oxazolyl rings in 1,4-Bis(4-phenyloxazol-2-yl)benzene?

There are two phenyl groups attached to the oxazolyl rings in 1,4-Bis(4-phenyloxazol-2-yl)benzene.