1,4-Bis(4-methyl-4,5-dihydrooxazol-2-yl)benzene

Catalog Number	ACM91786399
CAS	91786-39-9
Synonyms	4-Methyl-2-[4-(4-Methyl-4,5-Dihydro-1,3-Oxazol-2-Yl)Phenyl]-4,5-Dihydro-1,3-Oxazole
IUPAC Name	4-methyl-2-[4-(4-methyl-4,5-dihydro-1,3-oxazol-2-yl)phenyl]-4,5-dihydro-1,3-oxazole
Molecular Weight	244.29
Molecular Formula	C14H16N2O2
InChI	FYQUELMPDYVBFY-UHFFFAOYSA-N
InChI Key	InChI=1S/C14H16N2O2/c1-9-7-17-13(15-9)11-3-5-12(6-4-11)14-16-10(2)8-18-14/h3-6,9-10H,7-8H2,1-2H3
Purity	98%
Isomeric SMILES	CC1COC(=N1)C2=CC=C(C=C2)C3=NC(CO3)C

Q&A

What is the CAS number of the compound?

The CAS number of the compound is 91786-39-9.

What is the molecular weight of the compound?

The molecular weight of the compound is 244.29.

What is the product name of the compound?

The product name of the compound is Oxazole, 2,2'-(1,4-phenylene)bis[4,5-dihydro-4-methyl-.

What is the synonym for the compound?

A synonym for the compound is 1,4-Bis(4-methyl-4,5-dihydrooxazol-2-yl)benzene.

What is the molecular formula of the compound?

The molecular formula of the compound is C14H16N2O2.

What is the predicted boiling point of the compound?

The predicted boiling point of the compound is 383.2±25.0 °C.

What is the predicted pka value of the compound?

The predicted pka value of the compound is 4.61±0.70.

What is the predicted density of the compound?

The predicted density of the compound is 1.26±0.1 g/cm3.

How many oxazole rings are present in the compound?

There are two oxazole rings present in the compound.

How many 4-methyl-4,5-dihydrooxazol-2-yl groups are present in the compound?

There are two 4-methyl-4,5-dihydrooxazol-2-yl groups present in the compound.