1,4-Bis(2-phenyloxazol-4-yl)benzene

Catalog Number	ACM24171388
CAS	24171-38-8
Synonyms	1,4-Di-(2-Phenyloxazolyl) Benzene; 2-Phenyl-4-[4-(2-Phenyl-1,3-Oxazol-4-Yl)Phenyl]-1,3-Oxazole
IUPAC Name	2-phenyl-4-[4-(2-phenyl-1,3-oxazol-4-yl)phenyl]-1,3-oxazole
Molecular Weight	364.40
Molecular Formula	C24H16N2O2
InChI	WVGGQEKOYSUUOQ-UHFFFAOYSA-N
InChI Key	InChI=1S/C24H16N2O2/c1-3-7-19(8-4-1)23-25-21(15-27-23)17-11-13-18(14-12-17)22-16-28-24(26-22)20-9-5-2-6-10-20/h1-16H
Purity	98%
Isomeric SMILES	C1=CC=C(C=C1)C2=NC(=CO2)C3=CC=C(C=C3)C4=COC(=N4)C5=CC=CC=C5

Q&A

What is the molecular weight of 1,4-Bis(2-phenyloxazol-4-yl)benzene?

The molecular weight is 364.4.

What is the chemical formula of 1,4-Bis(2-phenyloxazol-4-yl)benzene?

The chemical formula is C24H16N2O2.

What is the predicted melting point of 1,4-Bis(2-phenyloxazol-4-yl)benzene?

The predicted melting point is 225 °C.

What is the predicted density of 1,4-Bis(2-phenyloxazol-4-yl)benzene?

The predicted density is 1.204±0.06 g/cm3.

What is the predicted boiling point of 1,4-Bis(2-phenyloxazol-4-yl)benzene?

The predicted boiling point is 604.9±65.0 °C.

What is the pka value of 1,4-Bis(2-phenyloxazol-4-yl)benzene?

The pka value is -0.22±0.10.

What is the CAS number of 1,4-Bis(2-phenyloxazol-4-yl)benzene?

The CAS number is 24171-38-8.

What are the synonyms of 1,4-Bis(2-phenyloxazol-4-yl)benzene?

The synonyms are Oxazole, 4,4'-p-phenylenebis[2-phenyl- (8CI) and 1,4-Bis(2-phenyloxazol-4-yl)benzene.

What is the molecular formula of 1,4-Bis(2-phenyloxazol-4-yl)benzene?

The molecular formula is C24H16N2O2.