1,4,8,11-Tetramethyl-1,4,8,11-tetraazacyclotetradecane

Catalog Number	ACM41203229-1
CAS	41203-22-9
Structure
Synonyms	Tetramethylcyclam; 1,4,8,11-Tetraazacyclotetradecane, 1,4,8,11-tetramethyl-
IUPAC Name	1,4,8,11-tetramethyl-1,4,8,11-tetrazacyclotetradecane
Molecular Weight	256.43
Molecular Formula	C14H32N4
Canonical SMILES	CN1CCCN(CCN(CCCN(CC1)C)C)C
InChI	HRFJEOWVAGSJNW-UHFFFAOYSA-N
InChI Key	InChI=1S/C14H32N4/c1-15-7-5-8-17(3)13-14-18(4)10-6-9-16(2)12-11-15/h5-14H2,1-4H3
Boiling Point	130-135 ºC at 0.2 Torr
Melting Point	38-42 °C-lit.
Appearance	White waxy crystal
Complexity	168
Covalently-Bonded Unit Count	1
Exact Mass	256.26269704
Heavy Atom Count	18
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	0
Monoisotopic Mass	256.26269704
Rotatable Bond Count	0
Topological Polar Surface Area	13 Ų

Q&A

What is the CAS number of 1,4,8,11-Tetramethyl-1,4,8,11-tetraazacyclotetradecane?

The CAS number of 1,4,8,11-Tetramethyl-1,4,8,11-tetraazacyclotetradecane is 41203-22-9.

What is the molecular weight of 1,4,8,11-Tetramethyl-1,4,8,11-tetraazacyclotetradecane?

The molecular weight of 1,4,8,11-Tetramethyl-1,4,8,11-tetraazacyclotetradecane is 256.43.

What are the product categories that 1,4,8,11-Tetramethyl-1,4,8,11-tetraazacyclotetradecane falls under?

The product categories include Chelation/Complexation Compounds, Crown Ethers, Synthetic Reagents, Amine Monomers, Crown Ethers Monomers, Tertiary Amines, organic amine, Achiral Nitrogen, and Cy-N.

What is another name for 1,4,8,11-Tetramethyl-1,4,8,11-tetraazacyclotetradecane?

Another name for 1,4,8,11-Tetramethyl-1,4,8,11-tetraazacyclotetradecane is N,N',N'',N'''-Tetramethyl-1,4,8,11-tetraazacyclotetradecane.

What is the melting point of 1,4,8,11-Tetramethyl-1,4,8,11-tetraazacyclotetradecane?

The melting point of 1,4,8,11-Tetramethyl-1,4,8,11-tetraazacyclotetradecane is 38-42 °C.

Is 1,4,8,11-Tetramethyl-1,4,8,11-tetraazacyclotetradecane hygroscopic?

Yes, 1,4,8,11-Tetramethyl-1,4,8,11-tetraazacyclotetradecane is sensitive and hygroscopic.

What is the hazard code for 1,4,8,11-Tetramethyl-1,4,8,11-tetraazacyclotetradecane?

The hazard code for 1,4,8,11-Tetramethyl-1,4,8,11-tetraazacyclotetradecane is Xi.

How is 1,4,8,11-Tetramethyl-1,4,8,11-tetraazacyclotetradecane commonly used?

1,4,8,11-Tetramethyl-1,4,8,11-tetraazacyclotetradecane is commonly used as a macrocyclic chelating agent in coordination chemistry and as a ligand that binds strongly to a wide range of metal ions.

What is the chemical property of 1,4,8,11-Tetramethyl-1,4,8,11-tetraazacyclotetradecane?

The chemical property is described as white to slightly yellow low melting crystalline.

Can 1,4,8,11-Tetramethyl-1,4,8,11-tetraazacyclotetradecane be used in water?

Yes, 1,4,8,11-Tetramethyl-1,4,8,11-tetraazacyclotetradecane is soluble in water.