1,3-Dimethyl-1H-benzo[d]imidazol-3-ium iodide

Catalog Number	ACM7181875-1
CAS	7181-87-5
Structure
Synonyms	1,3-Dimethyl-1H-benzimidazolium iodide
IUPAC Name	1,3-dimethylbenzimidazol-3-ium;iodide
Molecular Weight	274.10
Molecular Formula	C9H11IN2
InChI	RQGURHMTNSNBQX-UHFFFAOYSA-M
InChI Key	InChI=1S/C9H11N2.HI/c1-10-7-11(2)9-6-4-3-5-8(9)10;/h3-7H,1-2H3;1H/q+1;/p-1
Melting Point	134-142 °C
Purity	97%
Appearance	Solid
Isomeric SMILES	CN1C=[N+](C2=CC=CC=C21)C.[I-]

Q&A

What is the chemical formula for 1,3-Dimethyl-1H-benzo[d]imidazol-3-ium iodide?

The chemical formula is C9H11IN2.

What is the molecular weight of 1,3-Dimethyl-1H-benzo[d]imidazol-3-ium iodide?

The molecular weight is 274.

What are some synonyms for 1,3-Dimethyl-1H-benzo[d]imidazol-3-ium iodide?

Some synonyms are N,N'-Dimethylbenzimidazolium iodide, 1,3-Dimethylbenzimidazolium iodide, and 1,3-Dimethyl-1H-benzimidazol-3-ium iodide.

What is the melting point of 1,3-Dimethyl-1H-benzo[d]imidazol-3-ium iodide?

The melting point is 137-142°C.

How should 1,3-Dimethyl-1H-benzo[d]imidazol-3-ium iodide be stored?

It should be stored under inert gas (nitrogen or Argon) at 2-8 °C.

What is the Water Germany classification for 1,3-Dimethyl-1H-benzo[d]imidazol-3-ium iodide?

The Water Germany classification is 2.

What is the HS Code for 1,3-Dimethyl-1H-benzo[d]imidazol-3-ium iodide?

The HS Code is 2933998090.

What are some uses of 1,3-Dimethyl-1H-benzo[d]imidazol-3-ium iodide?

It is used as a catalyst for domino ring-opening redox amidation, Knoevenagel condensation, intramolecular stereoselective protonation, Grignard allylic substitution, acylation of alcohols, and Umpolung reactions.

What are some safety precautions to take when handling 1,3-Dimethyl-1H-benzo[d]imidazol-3-ium iodide?

It should be handled under inert gas and stored at a specific temperature.

What is the chemical structure of 1,3-Dimethyl-1H-benzo[d]imidazol-3-ium iodide?

The chemical structure is C9H11IN2.