1,3-Dimesityl-1H-imidazol-3-ium hydrogen carbonate

Catalog Number	ACM1372124930-1
CAS	1372124-93-0
Synonyms	1,3-Bis(2,4,6-Trimethylphenyl)Imidazolium Bicarbonate
IUPAC Name	1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium;hydrogen carbonate
Molecular Weight	366.45
Molecular Formula	C22H26N2O3
InChI	XLNGZTAIJOOIFH-UHFFFAOYSA-M
InChI Key	InChI=1S/C21H25N2.CH2O3/c1-14-9-16(3)20(17(4)10-14)22-7-8-23(13-22)21-18(5)11-15(2)12-19(21)6;2-1(3)4/h7-13H,1-6H3;(H2,2,3,4)/q+1;/p-1
Purity	98%
Appearance	Solid
Isomeric SMILES	CC1=CC(=C(C(=C1)C)N2C=C[N+](=C2)C3=C(C=C(C=C3C)C)C)C.C(=O)(O)[O-]

Q&A

What is the CAS number for 1,3-Bis(2,4,6-trimethylphenyl)imidazolium bicarbonate?

The CAS number is 1372124-93-0.

What is the molecular weight of 1,3-Bis(2,4,6-trimethylphenyl)imidazolium bicarbonate?

The molecular weight is 366.45344.

What are some synonyms for 1,3-Bis(2,4,6-trimethylphenyl)imidazolium bicarbonate?

Some synonyms include 1,3-BIS(2,4,6-TRIMETHYLPHENYL)IMIDAZOLIUMBICARBONATE and 1,3-Dimesityl-1H-imidazol-3-ium hydrogen carbonate.

What is the molecular formula of 1,3-Bis(2,4,6-trimethylphenyl)imidazolium bicarbonate?

The molecular formula is C22H26N2O3.

How should this compound be stored?

It should be stored under inert gas (nitrogen or Argon) at 2-8°C.

What is the color of 1,3-Bis(2,4,6-trimethylphenyl)imidazolium bicarbonate?

The color is white to yellow-orange.

In what form does this compound come?

It comes in the form of a powder.

How is 1,3-Bis(2,4,6-trimethylphenyl)imidazolium bicarbonate sensitive?

It is moisture sensitive.

What reactions is this compound used for?

It is used as a source of NHC's and can be transferred to transition metals. It is also used in the benzoin condensation reaction.

What is the purpose of using 1,3-Bis(2,4,6-trimethylphenyl)imidazolium bicarbonate in the benzoin condensation reaction?

It is used as a catalyst in the benzoin condensation reaction.