ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

1,3-Dimesityl-1H-imidazol-3-ium tetrafluoroborate

Catalog Number ACM286014537-1
CAS 286014-53-7
Structure {[CurrentData.Name]}
Synonyms 1,3-Bis(2,4,6-Trimethylphenyl)Imidazolium Tetrafluoroborate
IUPAC Name 1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium;tetrafluoroborate
Molecular Weight 392.24
Molecular Formula C21H25BF4N2
InChI VMNIOVNFFKZSAL-UHFFFAOYSA-N
InChI Key InChI=1S/C21H25N2.BF4/c1-14-9-16(3)20(17(4)10-14)22-7-8-23(13-22)21-18(5)11-15(2)12-19(21)6;2-1(3,4)5/h7-13H,1-6H3;/q+1;-1
Melting Point 240-243 °C
Purity 98%
Isomeric SMILES [B-](F)(F)(F)F.CC1=CC(=C(C(=C1)C)N2C=C[N+](=C2)C3=C(C=C(C=C3C)C)C)C
Q&A

What is the CAS number for 1,3-Dimesityl-1H-imidazol-3-ium tetrafluoroborate?

The CAS number is 286014-53-7.

What is the molecular weight of 1,3-Dimesityl-1H-imidazol-3-ium tetrafluoroborate?

The molecular weight is 392.24.

What is the product name for this compound?

The product name is 1,3-BIS(2,4,6-TRIMETHYLPHENYL)-IMIDAZOLIDINIUM-TETRAFLUOROBORATE.

What are some synonyms for 1,3-Dimesityl-1H-imidazol-3-ium tetrafluoroborate?

Some synonyms include 1,3-BIS(2,4,6-TRIMETHYLPHENYL)-IMIDAZOLIDINIUM-TETRAFLUOROBORATE, IMesBF4, and 1,3-bis(2,4,6-trimethylphenyl)imidazolinium tetrafluoroborate.

What is the melting point of 1,3-Dimesityl-1H-imidazol-3-ium tetrafluoroborate?

The melting point is 240-243℃.

How should 1,3-Dimesityl-1H-imidazol-3-ium tetrafluoroborate be stored?

It should be stored at 2-8°C.

What are the risk statements associated with this compound?

The risk statements are 36/37/38.

What safety statements should be followed when handling 1,3-Dimesityl-1H-imidazol-3-ium tetrafluoroborate?

Safety statements 26-36/37/39 should be followed.

What is the chemical formula for 1,3-Dimesityl-1H-imidazol-3-ium tetrafluoroborate?

The chemical formula is C21H25BF4N2.

What is another name for 1,3-Dimesityl-1H-imidazol-3-ium tetrafluoroborate?

Another name for this compound is 1,3-Bis(2,4,6-trimethylphenyl)-1H-imidazolium Tetrafluoroborate.

Please kindly note that our products and services are for research use only.