ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

1,3-Diisopropyl-1H-imidazol-3-ium chloride

Catalog Number ACM139143092-3
CAS 139143-09-2
Structure {[CurrentData.Name]}
Synonyms N,N'-(Isopropyl)imidazolium chloride
IUPAC Name 1,3-di(propan-2-yl)imidazol-1-ium;chloride
Molecular Weight 188.70
Molecular Formula C9H17ClN2
InChI DOFXKPAOJLLPII-UHFFFAOYSA-M
InChI Key InChI=1S/C9H17N2.ClH/c1-8(2)10-5-6-11(7-10)9(3)4;/h5-9H,1-4H3;1H/q+1;/p-1
Melting Point 182-186 °C
Purity 97%
Appearance Solid
Isomeric SMILES CC(C)N1C=C[N+](=C1)C(C)C.[Cl-]
Q&A

What is the chemical name of 1,3-Diisopropyl-1H-imidazol-3-ium chloride?

The chemical name of 1,3-Diisopropyl-1H-imidazol-3-ium chloride is 1,3-Diisopropylimidazolium chloride.

What is the molecular weight of 1,3-Diisopropyl-1H-imidazol-3-ium chloride?

The molecular weight of 1,3-Diisopropyl-1H-imidazol-3-ium chloride is 188.7.

What are the synonyms for 1,3-Diisopropyl-1H-imidazol-3-ium chloride?

The synonyms for 1,3-Diisopropyl-1H-imidazol-3-ium chloride are N,N'-(ISOPROPYL)IMIDAZOLIUM CHLORIDE, DIIC, 1,3-BIS(2,6-DI-I-PROPYLPHENYL)IMIDAZOLIUM CHLORIDE, and others.

What is the melting point of 1,3-Diisopropyl-1H-imidazol-3-ium chloride?

The melting point of 1,3-Diisopropyl-1H-imidazol-3-ium chloride is 278 °C (dec.)(lit.).

Is 1,3-Diisopropyl-1H-imidazol-3-ium chloride moisture sensitive?

Yes, 1,3-Diisopropyl-1H-imidazol-3-ium chloride is moisture sensitive.

What is the form of 1,3-Diisopropyl-1H-imidazol-3-ium chloride?

The compound is in the form of crystalline powder.

How is the water solubility of 1,3-Diisopropyl-1H-imidazol-3-ium chloride?

The compound is soluble in water.

What are the hazard codes associated with 1,3-Diisopropyl-1H-imidazol-3-ium chloride?

The hazard code associated with 1,3-Diisopropyl-1H-imidazol-3-ium chloride is Xi.

What is one of the uses of 1,3-Diisopropyl-1H-imidazol-3-ium chloride?

One of the uses of 1,3-Diisopropyl-1H-imidazol-3-ium chloride is as a ligand for ruthenium-catalyzed greener amide bond formation by dehydrogenative coupling of amines and alcohols.

How is 1,3-Diisopropyl-1H-imidazol-3-ium chloride described in terms of chemical properties?

The compound is described as being off-white to light beige crystalline powder.

Please kindly note that our products and services are for research use only.