1,3-Dibenzyl-1H-benzo[d]imidazol-3-ium chloride

Catalog Number	ACM36339136
CAS	36339-13-6
Structure
Synonyms	1H-Benzimidazolium, 1,3-bis(phenylmethyl)-, chloride
IUPAC Name	1,3-dibenzylbenzimidazol-3-ium;chloride
Molecular Weight	334.84
Molecular Formula	C21H19ClN2
InChI	CSFOFEZIBMHEPB-UHFFFAOYSA-M
InChI Key	InChI=1S/C21H19N2.ClH/c1-3-9-18(10-4-1)15-22-17-23(16-19-11-5-2-6-12-19)21-14-8-7-13-20(21)22;/h1-14,17H,15-16H2;1H/q+1;/p-1
Melting Point	210-212 °C
Purity	97%
Isomeric SMILES	C1=CC=C(C=C1)CN2C=[N+](C3=CC=CC=C32)CC4=CC=CC=C4.[Cl-]

Q&A

What is the chemical name of the compound with CAS number 36339-13-6?

The chemical name of the compound is 1,3-Dibenzyl-1H-benzo[d]imidazol-3-ium chloride.

What are the synonyms for 1,3-Dibenzyl-1H-benzo[d]imidazol-3-ium chloride?

The synonyms are 1,3-Dibenzyl-1H-benzo[d]imidazol-3-ium chloride, 1,3-Dibenzyl-1H-1,3-benzodiazol-3-ium chloride, 1H-Benzimidazolium, 1,3-bis(phenylmethyl)-, chloride.

What is the molecular weight of 1,3-Dibenzyl-1H-benzo[d]imidazol-3-ium chloride?

The molecular weight is 334.85.

What is the melting point of 1,3-Dibenzyl-1H-benzo[d]imidazol-3-ium chloride and in what solvent?

The melting point is 210-212 °C in dichloromethane.

What are the solubility properties of 1,3-Dibenzyl-1H-benzo[d]imidazol-3-ium chloride?

It is slightly soluble in DMSO (Sonicated) and methanol.

What is the color of 1,3-Dibenzyl-1H-benzo[d]imidazol-3-ium chloride?

The color is White to Off-White.

How should 1,3-Dibenzyl-1H-benzo[d]imidazol-3-ium chloride be stored?

It should be stored under inert gas (nitrogen or Argon) at 2-8°C.

In what form is 1,3-Dibenzyl-1H-benzo[d]imidazol-3-ium chloride?

It is in solid form.

What is the stability of 1,3-Dibenzyl-1H-benzo[d]imidazol-3-ium chloride?

It is hygroscopic.

What is the main use of 1,3-Dibenzyl-1H-benzo[d]imidazol-3-ium chloride?

It is a useful reagent in the preparation of antimicrobial benzimidazolium compounds via N-alkylation of benzimidazoles with benzyl chloride.